| id | C00006614 |
|---|---|
| Name | Cyanidin |
| CAS RN | 528-58-5 |
| Standard InChI | InChI=1S/C15H10O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-6H,(H4-,16,17,18,19,20)/p+1 |
| Standard InChI (Main Layer) | InChI=1S/C15H10O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-6H,(H4-,16,17,18,19,20) |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 71 |
| By standard InChI | CHEMBL404515 |
|---|---|
| By standard InChI Main Layer | CHEMBL404515 |
| By LinkDB | C05905 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 4 |
| rosids | 3 |
| eudicotyledons | 2 |
| Liliopsida | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Polygonaceae | 2 |
| Cupressaceae | 2 |
| Pinaceae | 2 |
| Bromeliaceae | 1 |
| Malvaceae | 1 |
| Brassicaceae | 1 |
| Fabaceae | 1 |
| Cornaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL404515 |
CHEMBL971904
(1)
CHEMBL1008495
(1)
CHEMBL1008503 (1) |
0 / 3 |
| P28907 | ADP-ribosyl cyclase 1 | Enzyme | CHEMBL404515 |
CHEMBL1285540
(1)
CHEMBL1799589
(1)
|
0 / 1 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL404515 |
CHEMBL971903
(1)
CHEMBL1008496
(1)
CHEMBL1008502 (1) |
0 / 0 |