| id | C00000662 |
|---|---|
| Name | Caffeoyl tyramine |
| CAS RN | 103188-48-3 |
| Standard InChI | InChI=1S/C17H17NO4/c19-14-5-1-12(2-6-14)9-10-18-17(22)8-4-13-3-7-15(20)16(21)11-13/h1-8,11,19-21H,9-10H2,(H,18,22)/b8-4+ |
| Standard InChI (Main Layer) | InChI=1S/C17H17NO4/c19-14-5-1-12(2-6-14)9-10-18-17(22)8-4-13-3-7-15(20)16(21)11-13/h1-8,11,19-21H,9-10H2,(H,18,22) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 499 |
| By standard InChI | CHEMBL206646 |
|---|---|
| By standard InChI Main Layer | CHEMBL206646 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Salicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Populus trichocarpa | 3694 | Salicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL206646 |
CHEMBL870666
(1)
CHEMBL1064098
(1)
|
4 / 2 |