| id | C00006922 |
|---|---|
| Name | Echinatin |
| CAS RN | 34221-41-5 |
| Standard InChI | InChI=1S/C16H14O4/c1-20-16-10-14(18)8-4-12(16)5-9-15(19)11-2-6-13(17)7-3-11/h2-10,17-18H,1H3/b9-5+ |
| Standard InChI (Main Layer) | InChI=1S/C16H14O4/c1-20-16-10-14(18)8-4-12(16)5-9-15(19)11-2-6-13(17)7-3-11/h2-10,17-18H,1H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 92 |
| By standard InChI | CHEMBL141530 |
|---|---|
| By standard InChI Main Layer | CHEMBL141530 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL141530 |
CHEMBL1041717
(1)
|
0 / 0 |
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL141530 |
CHEMBL1068398
(1)
|
5 / 3 |