| id | C00007095 |
|---|---|
| Name | Broussochalcone A |
| CAS RN | 99217-68-2 |
| Standard InChI | InChI=1S/C20H20O5/c1-12(2)3-6-14-10-15(19(24)11-18(14)23)16(21)7-4-13-5-8-17(22)20(25)9-13/h3-5,7-11,22-25H,6H2,1-2H3/b7-4+ |
| Standard InChI (Main Layer) | InChI=1S/C20H20O5/c1-12(2)3-6-14-10-15(19(24)11-18(14)23)16(21)7-4-13-5-8-17(22)20(25)9-13/h3-5,7-11,22-25H,6H2,1-2H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 133 |
| By standard InChI | CHEMBL115452 |
|---|---|
| By standard InChI Main Layer | CHEMBL115452 |
| By LinkDB |
|---|
| By CAS RN | C106525 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL115452 |
CHEMBL771170
(1)
|
0 / 0 |
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL115452 |
CHEMBL949646
(1)
|
2 / 2 |