| id | C00007249 |
|---|---|
| Name | THF / THFA / Tetrahydrofolate / Tetrahydrofolic acid |
| CAS RN | 135-16-0 |
| Standard InChI | InChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30)/t11?,12-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C19H23N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,11-12,21,23H,5-8H2,(H,24,29)(H,27,28)(H,31,32)(H4,20,22,25,26,30) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1399 |
| By standard InChI | CHEMBL2021342 |
|---|---|
| By standard InChI Main Layer | CHEMBL2021342 CHEMBL2074655 |
| By LinkDB | C00101 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| Enterobacteriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q05932 | Folylpolyglutamate synthase, mitochondrial | Enzyme | CHEMBL2021342 |
CHEMBL678794
(1)
CHEMBL678885
(1)
|
0 / 0 |