| id | C00007325 |
|---|---|
| Name | cis-Zeatin |
| CAS RN | 32771-64-5 |
| Standard InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2- |
| Standard InChI (Main Layer) | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2879 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL525239 |
| By LinkDB | C15545 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL525239 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL525239 |
CHEMBL1613829
(1)
|
0 / 0 |