| id | C00007479 |
|---|---|
| Name | L-Histidinol |
| CAS RN | 4836-52-6 |
| Standard InChI | InChI=1S/C6H11N3O/c7-5(3-10)1-6-2-8-4-9-6/h2,4-5,10H,1,3,7H2,(H,8,9)/t5-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C6H11N3O/c7-5(3-10)1-6-2-8-4-9-6/h2,4-5,10H,1,3,7H2,(H,8,9) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4250 |
| By standard InChI | CHEMBL278081 |
|---|---|
| By standard InChI Main Layer | CHEMBL278081 CHEMBL19588 CHEMBL2007999 |
| By LinkDB | C00860 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Enterobacteriaceae | 1 |
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL278081 |
CHEMBL1614211
(1)
|
0 / 0 |