| id | C00007543 |
|---|---|
| Name | 4-Hydroxysphinganine |
| CAS RN | 13552-11-9 |
| Standard InChI | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-17(21)18(22)16(19)15-20/h16-18,20-22H,2-15,19H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3086 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL236036 CHEMBL466395 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL236036 |
CHEMBL1794311
(1)
|
2 / 3 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL236036 |
CHEMBL1794536
(1)
|
0 / 0 |