| id | C00007623 |
|---|---|
| Name | 2-Ketoisovalerate / alpha-Ketoisovalerate / 3-Methyl-2-oxobutanoic acid |
| CAS RN | 759-05-7 |
| Standard InChI | InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8) |
| Standard InChI (Main Layer) | InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5279 |
| By standard InChI | CHEMBL146554 |
|---|---|
| By standard InChI Main Layer | CHEMBL146554 |
| By LinkDB | C00141 |
|---|
| By CAS RN | C001505 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Brassicaceae | 1 |
| Enterobacteriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
| Escherichia coli K12 | 83333 | Enterobacteriaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O15427 | Monocarboxylate transporter 4 | Unclassified protein | CHEMBL146554 |
CHEMBL2076227
(1)
|
0 / 0 |