id | C00007623 |
---|---|
Name | 2-Ketoisovalerate / alpha-Ketoisovalerate / 3-Methyl-2-oxobutanoic acid |
CAS RN | 759-05-7 |
Standard InChI | InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8) |
Standard InChI (Main Layer) | InChI=1S/C5H8O3/c1-3(2)4(6)5(7)8/h3H,1-2H3,(H,7,8) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 5279 |
By standard InChI | CHEMBL146554 |
---|---|
By standard InChI Main Layer | CHEMBL146554 |
By LinkDB | C00141 |
---|
By CAS RN | C001505 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Brassicaceae | 1 |
Enterobacteriaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Arabidopsis thaliana | 3702 | Brassicaceae | rosids | Viridiplantae |
Escherichia coli K12 | 83333 | Enterobacteriaceae | Bacteria |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O15427 | Monocarboxylate transporter 4 | Unclassified protein | CHEMBL146554 |
CHEMBL2076227
(1)
|
0 / 0 |