| id | C00000793 |
|---|---|
| Name | N-AcDMPT / N-Acethyldemethylphosphinothricin |
| CAS RN | 114496-36-5 |
| Standard InChI | InChI=1S/C6H12NO5P/c1-4(8)7-5(6(9)10)2-3-13(11)12/h5,13H,2-3H2,1H3,(H,7,8)(H,9,10)(H,11,12) |
| Standard InChI (Main Layer) | InChI=1S/C6H12NO5P/c1-4(8)7-5(6(9)10)2-3-13(11)12/h5,13H,2-3H2,1H3,(H,7,8)(H,9,10)(H,11,12) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8712 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces hygroscopicus | 1912 | Streptomycetaceae | Bacteria |