| id | C00008025 |
|---|---|
| Name | 4,6,4'-Trihydroxyaurone |
| CAS RN | 25078-14-2 |
| Standard InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)5-13-15(19)14-11(18)6-10(17)7-12(14)20-13/h1-7,16-18H |
| Standard InChI (Main Layer) | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)5-13-15(19)14-11(18)6-10(17)7-12(14)20-13/h1-7,16-18H |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 450 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL201626 CHEMBL466981 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Asparagaceae | 1 |
| Plumbaginaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Asparagus gonocladus | 1120561 | Asparagaceae | Liliopsida | Viridiplantae |
| Limonium sp. | 46093 | Plumbaginaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P15559 | NAD(P)H dehydrogenase [quinone] 1 | Enzyme | CHEMBL201626 |
CHEMBL1175292
(1)
CHEMBL1175293
(1)
CHEMBL1175421 (1) |
0 / 0 |
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL201626 |
CHEMBL858776
(1)
CHEMBL858777
(1)
CHEMBL858778 (1) CHEMBL858779 (1) CHEMBL858780 (1) CHEMBL858823 (1) CHEMBL858824 (1) CHEMBL858825 (1) |
4 / 2 |