| id | C00000811 | 
|---|---|
| Name | (-)-Menthone | 
| CAS RN | 14073-97-3 | 
| Standard InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3 | 
| Phytochemical cluster | No. 35 | 
|---|---|
| KCF-S cluster | No. 1288 | 
| By standard InChI | CHEMBL276311 | 
|---|---|
| By standard InChI Main Layer | CHEMBL276311 CHEMBL1719455 | 
| By LinkDB | C00843 | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Mentha gattefosse | 21819 | Lamiaceae | asterids | Viridiplantae | 
| Mentha piperita L. | 21819 | Lamiaceae | asterids | Viridiplantae | 
| Mentha spp. | 21819 | Lamiaceae | asterids | Viridiplantae | 
| Mentha x piperita L. | 34256 | Lamiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1719455 | CHEMBL1738606
                        (1) | 0 / 0 |