| id | C00008198 |
|---|---|
| Name | Methyl-liquiritigenin |
| CAS RN | 61504-06-1 |
| Standard InChI | InChI=1S/C16H14O4/c1-19-12-6-7-13-14(18)9-15(20-16(13)8-12)10-2-4-11(17)5-3-10/h2-8,15,17H,9H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H14O4/c1-19-12-6-7-13-14(18)9-15(20-16(13)8-12)10-2-4-11(17)5-3-10/h2-8,15,17H,9H2,1H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 25 |
| By standard InChI | CHEMBL402970 |
|---|---|
| By standard InChI Main Layer | CHEMBL402970 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Fabaceae | 1 |
| Xanthorrhoeaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bauhinia manca | 3805 | Fabaceae | rosids | Viridiplantae |
| Xanthorrhoea spp. | 39536 | Xanthorrhoeaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL402970 |
CHEMBL932215
(1)
CHEMBL932216
(1)
|
2 / 2 |