| id | C00008282 |
|---|---|
| Name | Isookaninglucoside |
| CAS RN | 577-38-8 |
| Standard InChI | InChI=1S/C21H22O11/c22-7-15-16(26)18(28)19(29)21(32-15)31-13-4-2-9-11(24)6-14(30-20(9)17(13)27)8-1-3-10(23)12(25)5-8/h1-5,14-16,18-19,21-23,25-29H,6-7H2/t14?,15?,16-,18+,19?,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O11/c22-7-15-16(26)18(28)19(29)21(32-15)31-13-4-2-9-11(24)6-14(30-20(9)17(13)27)8-1-3-10(23)12(25)5-8/h1-5,14-16,18-19,21-23,25-29H,6-7H2 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 12 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1405715 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| Pinaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Abies pindrow | 425843 | Pinaceae | Spermatophyta | Viridiplantae |
| Bidens spp. | 42336 | Asteraceae | asterids | Viridiplantae |
| Coreopsis spp. | 13448 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1405715 |
CHEMBL1614211
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1405715 |
CHEMBL1794536
(1)
|
0 / 0 |