id | C00008291 |
---|---|
Name | Miscanthoside / Eriodictyol 7-O-glucoside / (2S)-Eriodictyol 7-O-beta-D-glucopyranoside |
CAS RN | 38965-51-4 |
Standard InChI | InChI=1S/C21H22O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-5,14,16,18-25,27-29H,6-7H2/t14?,16?,18-,19+,20?,21-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C21H22O11/c22-7-16-18(27)19(28)20(29)21(32-16)30-9-4-12(25)17-13(26)6-14(31-15(17)5-9)8-1-2-10(23)11(24)3-8/h1-5,14,16,18-25,27-29H,6-7H2 |
Phytochemical cluster | No. 14 |
---|---|
KCF-S cluster | No. 12 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL509624 CHEMBL1602917 |
By LinkDB |
---|
By CAS RN |
---|
class name | count |
---|---|
eudicotyledons | 2 |
rosids | 1 |
asterids | 1 |
family name | count |
---|---|
Viscaceae | 1 |
Phyllanthaceae | 1 |
Lamiaceae | 1 |
Balanophoraceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Elsholtzia bodinieri | 41225 | Lamiaceae | asterids | Viridiplantae |
Lophophytum spp. | 25673 | Balanophoraceae | eudicotyledons | Viridiplantae |
Phyllanthus emblica | 296036 | Phyllanthaceae | rosids | Viridiplantae |
Viscum coloratum (KOMAR) NAKAI | 3971 | Viscaceae | eudicotyledons | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1602917 |
CHEMBL1614211
(1)
|
0 / 0 |
Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1602917 |
CHEMBL1794536
(1)
|
0 / 0 |