| id | C00008525 |
|---|---|
| Name | Sophoraflavanone I |
| CAS RN | 136997-69-8 |
| Standard InChI | InChI=1S/C39H38O9/c1-19(2)5-6-22(20(3)4)13-28-30(43)16-32(45)37-33(46)18-34(48-39(28)37)27-15-29-35(17-31(27)44)47-38(21-7-9-24(40)10-8-21)36(29)23-11-25(41)14-26(42)12-23/h5,7-12,14-17,22,34,36,38,40-45H,3,6,13,18H2,1-2,4H3 |
| Standard InChI (Main Layer) | InChI=1S/C39H38O9/c1-19(2)5-6-22(20(3)4)13-28-30(43)16-32(45)37-33(46)18-34(48-39(28)37)27-15-29-35(17-31(27)44)47-38(21-7-9-24(40)10-8-21)36(29)23-11-25(41)14-26(42)12-23/h5,7-12,14-17,22,34,36,38,40-45H,3,6,13,18H2,1-2,4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 669 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sophora davidii | 49839 | Fabaceae | rosids | Viridiplantae |
| Sophora leachiana | 3896 | Fabaceae | rosids | Viridiplantae |
| Sophora moorcroftiana | 1323965 | Fabaceae | rosids | Viridiplantae |