| id | C00008704 |
|---|---|
| Name | Isoastibin |
| CAS RN | 54081-48-0 |
| Standard InChI | InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3/t7?,15-,17?,18-,19+,20+,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 12 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL486017 CHEMBL1159406 CHEMBL1159407 CHEMBL1314522 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Juglandaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Engelhardtia chrysolepis | 139931 | Juglandaceae | rosids | Viridiplantae |
| Sphaerostephanos arbuscula |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL1314522 |
CHEMBL1794585
(1)
|
0 / 0 |
| P07237 | Protein disulfide-isomerase | Enzyme | CHEMBL1314522 |
CHEMBL1964080
(1)
CHEMBL2114805
(1)
|
0 / 0 |
| P11308 | Transcriptional regulator ERG | Unclassified protein | CHEMBL1314522 |
CHEMBL2114924
(1)
|
1 / 2 |
| Q9HC16 | DNA dC->dU-editing enzyme APOBEC-3G | Enzyme | CHEMBL1314522 |
CHEMBL1963863
(1)
|
0 / 0 |
| P68400 | Casein kinase II subunit alpha | Ck2 | CHEMBL1159406 CHEMBL1159407 |
CHEMBL620984
(2)
CHEMBL659494
(2)
|
0 / 0 |
| P19784 | Casein kinase II subunit alpha' | Ck2 | CHEMBL1159406 CHEMBL1159407 |
CHEMBL620984
(2)
CHEMBL659494
(2)
|
0 / 0 |
| P67870 | Casein kinase II subunit beta | REG serine/threonine protein kinase family | CHEMBL1159406 CHEMBL1159407 |
CHEMBL620984
(2)
CHEMBL659494
(2)
|
0 / 0 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL1314522 |
CHEMBL2114738
(1)
|
0 / 0 |