| id | C00009067 |
|---|---|
| Name | Catechin-(4alpha->8)-epiafzelechin |
| CAS RN | 80685-13-8 |
| Standard InChI | InChI=1S/C30H26O11/c31-14-4-1-12(2-5-14)28-22(38)10-16-18(34)11-21(37)25(30(16)41-28)26-24-20(36)8-15(32)9-23(24)40-29(27(26)39)13-3-6-17(33)19(35)7-13/h1-9,11,22,26-29,31-39H,10H2/t22-,26+,27+,28-,29-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H26O11/c31-14-4-1-12(2-5-14)28-22(38)10-16-18(34)11-21(37)25(30(16)41-28)26-24-20(36)8-15(32)9-23(24)40-29(27(26)39)13-3-6-17(33)19(35)7-13/h1-9,11,22,26-29,31-39H,10H2 |
| Phytochemical cluster | No. 19 |
|---|---|
| KCF-S cluster | No. 16 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL447023 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Wisteria sinensis | 20997 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL447023 |
CHEMBL1020816
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL447023 |
CHEMBL1020815
(1)
|
0 / 0 |