| id | C00009382 |
|---|---|
| Name | Isoformononetin |
| CAS RN | 486-63-5 |
| Standard InChI | InChI=1S/C16H12O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9,17H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H12O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9,17H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL453280 |
|---|---|
| By standard InChI Main Layer | CHEMBL453280 |
| By LinkDB | C12125 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycine max | 3847 | Fabaceae | rosids | Viridiplantae |
| Machaerium villosum | 450039 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P03372 | Estrogen receptor | NR3A1 | CHEMBL453280 |
CHEMBL1219555
(1)
CHEMBL1219558
(1)
CHEMBL1219559 (1) CHEMBL1219561 (1) |
1 / 1 |