| id | C00009382 | 
|---|---|
| Name | Isoformononetin | 
| CAS RN | 486-63-5 | 
| Standard InChI | InChI=1S/C16H12O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9,17H,1H3 | 
| Standard InChI (Main Layer) | InChI=1S/C16H12O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9,17H,1H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 3 | 
| By standard InChI | CHEMBL453280 | 
|---|---|
| By standard InChI Main Layer | CHEMBL453280 | 
| By LinkDB | C12125 | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Glycine max | 3847 | Fabaceae | rosids | Viridiplantae | 
| Machaerium villosum | 450039 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P03372 | Estrogen receptor | NR3A1 | CHEMBL453280 | CHEMBL1219555
                        (1)
                        CHEMBL1219558
                        (1) CHEMBL1219559 (1) CHEMBL1219561 (1) | 1 / 1 |