| id | C00009466 | 
|---|---|
| Name | Derrustone / 5,7-Dimethoxy-3',4'-methylenedioxyisoflavone | 
| CAS RN | 22044-59-3 | 
| Standard InChI | InChI=1S/C18H14O6/c1-20-11-6-15(21-2)17-16(7-11)22-8-12(18(17)19)10-3-4-13-14(5-10)24-9-23-13/h3-8H,9H2,1-2H3 | 
| Standard InChI (Main Layer) | InChI=1S/C18H14O6/c1-20-11-6-15(21-2)17-16(7-11)22-8-12(18(17)19)10-3-4-13-14(5-10)24-9-23-13/h3-8H,9H2,1-2H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 27 | 
| By standard InChI | CHEMBL252721 | 
|---|---|
| By standard InChI Main Layer | CHEMBL252721 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Derris robusta | 1225697 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL252721 | CHEMBL1613842
                        (1) | 4 / 2 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL252721 | CHEMBL1614458
                        (1) | 0 / 0 | 
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL252721 | CHEMBL1794467
                        (1) | 0 / 0 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL252721 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL252721 | CHEMBL1614421
                        (1) | 4 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #600274 | Frontotemporal dementia; ftd | P10636 | 
| #260540 | Parkinson-dementia syndrome | P10636 | 
| #172700 | Pick disease of brain | P10636 | 
| #253300 | Spinal muscular atrophy, type i; sma1 | Q16637 | 
| #253550 | Spinal muscular atrophy, type ii; sma2 | Q16637 | 
| #253400 | Spinal muscular atrophy, type iii; sma3 | Q16637 | 
| #271150 | Spinal muscular atrophy, type iv; sma4 | Q16637 | 
| #601104 | Supranuclear palsy, progressive, 1; psnp1 | P10636 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | P10636
                            (related) | 
| H00077 | Progressive supranuclear palsy (PSP) | P10636
                            (related) | 
| H00078 | Frontotemporal lobar degeneration (FTLD) | P10636
                            (related) | 
| H00455 | Spinal muscular atrophy (SMA) | Q16637
                            (related) Q16637 (related) |