| id | C00009639 | 
|---|---|
| Name | Neorautenol | 
| CAS RN | 53766-52-2 | 
| Standard InChI | InChI=1S/C20H18O4/c1-20(2)6-5-11-7-14-17(9-16(11)24-20)22-10-15-13-4-3-12(21)8-18(13)23-19(14)15/h3-9,15,19,21H,10H2,1-2H3 | 
| Standard InChI (Main Layer) | InChI=1S/C20H18O4/c1-20(2)6-5-11-7-14-17(9-16(11)24-20)22-10-15-13-4-3-12(21)8-18(13)23-19(14)15/h3-9,15,19,21H,10H2,1-2H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 135 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1098728 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Neorautanenia edulis | 167619 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL1098728 | CHEMBL1101504
                        (1) | 0 / 0 |