| id | C00000973 |
|---|---|
| Name | Isosakuranetin / 5,7-Dihydroxy-4'-methoxyflavanone |
| CAS RN | 480-43-3 |
| Standard InChI | InChI=1S/C16H14O5/c1-20-11-4-2-9(3-5-11)14-8-13(19)16-12(18)6-10(17)7-15(16)21-14/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H14O5/c1-20-11-4-2-9(3-5-11)14-8-13(19)16-12(18)6-10(17)7-15(16)21-14/h2-7,14,17-18H,8H2,1H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 25 |
| By standard InChI | CHEMBL470266 |
|---|---|
| By standard InChI Main Layer | CHEMBL470266 |
| By LinkDB | C05334 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 3 |
| rosids | 1 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 2 |
| Piperaceae | 1 |
| Rosaceae | 1 |
| Lamiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artemisia campestris | 72337 | Asteraceae | asterids | Viridiplantae |
| Piper crassinervium | 538253 | Piperaceae | Magnoliophyta | Viridiplantae |
| Prunus spp. | 3754 | Rosaceae | rosids | Viridiplantae |
| Salvia nicolsoniana | 21880 | Lamiaceae | asterids | Viridiplantae |
| Wyethia spp. | 53739 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04798 | Cytochrome P450 1A1 | Cytochrome P450 1A1 | CHEMBL470266 |
CHEMBL1225717
(1)
|
0 / 0 |
| Q16678 | Cytochrome P450 1B1 | Cytochrome P450 1B1 | CHEMBL470266 |
CHEMBL1225718
(1)
|
4 / 4 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL470266 |
CHEMBL1225716
(1)
|
0 / 0 |