| id | C00009768 |
|---|---|
| Name | 3-Hydroxy-8,9-dimethoxycoumestan |
| CAS RN | 5252-40-4 |
| Standard InChI | InChI=1S/C17H12O6/c1-20-13-6-10-12(7-14(13)21-2)22-16-9-4-3-8(18)5-11(9)23-17(19)15(10)16/h3-7,18H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H12O6/c1-20-13-6-10-12(7-14(13)21-2)22-16-9-4-3-8(18)5-11(9)23-17(19)15(10)16/h3-7,18H,1-2H3 |
| Phytochemical cluster | No. 17 |
|---|---|
| KCF-S cluster | No. 54 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Medicago sativa | 3879 | Fabaceae | rosids | Viridiplantae |
| Melilotus messanensis | 1279044 | Fabaceae | rosids | Viridiplantae |
| Myroxylon balsamum | 53906 | Fabaceae | rosids | Viridiplantae |