| id | C00009845 |
|---|---|
| Name | 8,4'-Dihydroxyisoflavone |
| CAS RN | 118024-87-6 |
| Standard InChI | InChI=1S/C15H10O4/c16-10-6-4-9(5-7-10)12-8-19-15-11(14(12)18)2-1-3-13(15)17/h1-8,16-17H |
| Standard InChI (Main Layer) | InChI=1S/C15H10O4/c16-10-6-4-9(5-7-10)12-8-19-15-11(14(12)18)2-1-3-13(15)17/h1-8,16-17H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 71 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Calopogonium mucunoides | 132433 | Fabaceae | rosids | Viridiplantae |