| id | C00009852 |
|---|---|
| Name | NSC 678112 / 8-Hydroxydaidzein / 7,8,4'-Trihydroxyisoflavone |
| CAS RN | 75187-63-2 |
| Standard InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-15-10(13(11)18)5-6-12(17)14(15)19/h1-7,16-17,19H |
| Standard InChI (Main Layer) | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-15-10(13(11)18)5-6-12(17)14(15)19/h1-7,16-17,19H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 71 |
| By standard InChI | CHEMBL242739 |
|---|---|
| By standard InChI Main Layer | CHEMBL242739 |
| By LinkDB |
|---|
| By CAS RN | C061214 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Fabaceae | 1 |
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Glycine max | 3847 | Fabaceae | rosids | Viridiplantae |
| Streptomyces sp. OH-1049 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL242739 |
CHEMBL991725
(1)
CHEMBL990777
(1)
|
1 / 1 |