id | C00009877 |
---|---|
Name | Glisoflavone / 7,3',4'-Trihydroxy-5-methoxy-5'-prenylisoflavone |
CAS RN | 125709-32-2 |
Standard InChI | InChI=1S/C21H20O6/c1-11(2)4-5-12-6-13(7-16(23)20(12)24)15-10-27-18-9-14(22)8-17(26-3)19(18)21(15)25/h4,6-10,22-24H,5H2,1-3H3 |
Standard InChI (Main Layer) | InChI=1S/C21H20O6/c1-11(2)4-5-12-6-13(7-16(23)20(12)24)15-10-27-18-9-14(22)8-17(26-3)19(18)21(15)25/h4,6-10,22-24H,5H2,1-3H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 15 |
By standard InChI | CHEMBL1223641 |
---|---|
By standard InChI Main Layer | CHEMBL1223641 |
By LinkDB |
---|
By CAS RN | C063349 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Glycyrrhiza spp. | 46347 | Fabaceae | rosids | Viridiplantae |
Glycyrrhiza uralensis | 74613 | Fabaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL1223641 |
CHEMBL1228967
(1)
CHEMBL1228972
(1)
|
0 / 0 |