| id | C00000853 |
|---|---|
| Name | Myrcene |
| CAS RN | 123-35-3 |
| Standard InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3 |
| Phytochemical cluster | No. 34 |
|---|---|
| KCF-S cluster | No. 2285 |
| By standard InChI | CHEMBL455491 |
|---|---|
| By standard InChI Main Layer | CHEMBL455491 |
| By LinkDB | C06074 |
|---|
| By CAS RN | C008574 |
|---|
| class name | count |
|---|---|
| rosids | 18 |
| asterids | 17 |
| Spermatophyta | 8 |
| Magnoliophyta | 7 |
| Liliopsida | 3 |
| eudicotyledons | 1 |
| Embryophyta | 1 |
| family name | count |
|---|---|
| Rutaceae | 10 |
| Pinaceae | 7 |
| Solanaceae | 4 |
| Asteraceae | 4 |
| Lamiaceae | 4 |
| Myrtaceae | 3 |
| Saururaceae | 3 |
| Brassicaceae | 2 |
| Zingiberaceae | 2 |
| Cistaceae | 2 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL455491 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL455491 |
CHEMBL1794456
(1)
|
0 / 1 |
| Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL455491 |
CHEMBL1794415
(1)
|
0 / 0 |