| id | C00010195 | 
|---|---|
| Name | Nordalbergin / 6,7-Dihydroxy-4-phenylcoumarin | 
| CAS RN | 482-82-6 | 
| Standard InChI | InChI=1S/C15H10O4/c16-12-6-11-10(9-4-2-1-3-5-9)7-15(18)19-14(11)8-13(12)17/h1-8,16-17H | 
| Standard InChI (Main Layer) | InChI=1S/C15H10O4/c16-12-6-11-10(9-4-2-1-3-5-9)7-15(18)19-14(11)8-13(12)17/h1-8,16-17H | 
| Phytochemical cluster | No. 17 | 
|---|---|
| KCF-S cluster | No. 54 | 
| By standard InChI | CHEMBL1255818 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1255818 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Dalbergia sissoo | 107308 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P15121 | Aldose reductase | Enzyme | CHEMBL1255818 | 
                        CHEMBL1260797
                        (1)
                         | 
                      0 / 0 | 
| Q00796 | Sorbitol dehydrogenase | Enzyme | CHEMBL1255818 | 
                        CHEMBL1260799
                        (1)
                         | 
                      0 / 0 |