| id | C00010195 |
|---|---|
| Name | Nordalbergin / 6,7-Dihydroxy-4-phenylcoumarin |
| CAS RN | 482-82-6 |
| Standard InChI | InChI=1S/C15H10O4/c16-12-6-11-10(9-4-2-1-3-5-9)7-15(18)19-14(11)8-13(12)17/h1-8,16-17H |
| Standard InChI (Main Layer) | InChI=1S/C15H10O4/c16-12-6-11-10(9-4-2-1-3-5-9)7-15(18)19-14(11)8-13(12)17/h1-8,16-17H |
| Phytochemical cluster | No. 17 |
|---|---|
| KCF-S cluster | No. 54 |
| By standard InChI | CHEMBL1255818 |
|---|---|
| By standard InChI Main Layer | CHEMBL1255818 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dalbergia sissoo | 107308 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P15121 | Aldose reductase | Enzyme | CHEMBL1255818 |
CHEMBL1260797
(1)
|
0 / 0 |
| Q00796 | Sorbitol dehydrogenase | Enzyme | CHEMBL1255818 |
CHEMBL1260799
(1)
|
0 / 0 |