| id | C00010785 |
|---|---|
| Name | Ligustroside |
| CAS RN | 35897-92-8 |
| Standard InChI | InChI=1S/C25H32O12/c1-3-15-16(10-19(28)34-9-8-13-4-6-14(27)7-5-13)17(23(32)33-2)12-35-24(15)37-25-22(31)21(30)20(29)18(11-26)36-25/h3-7,12,16,18,20-22,24-27,29-31H,8-11H2,1-2H3/b15-3+/t16-,18?,20+,21?,22-,24-,25-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C25H32O12/c1-3-15-16(10-19(28)34-9-8-13-4-6-14(27)7-5-13)17(23(32)33-2)12-35-24(15)37-25-22(31)21(30)20(29)18(11-26)36-25/h3-7,12,16,18,20-22,24-27,29-31H,8-11H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 243 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1086877 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Fraxinus excelsior L. | 38873 | Oleaceae | asterids | Viridiplantae |
| Ligustrum lucidum | 458695 | Oleaceae | asterids | Viridiplantae |
| Ligustrum obtusifolium | 178760 | Oleaceae | asterids | Viridiplantae |
| Phillyrea media | 126559 | Oleaceae | asterids | Viridiplantae |
| Syringa vulgaris L. | 24208 | Oleaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14672 | Solute carrier family 2, facilitated glucose transporter member 4 | Unclassified protein | CHEMBL1086877 |
CHEMBL1103148
(1)
|
1 / 0 |