| id | C00001094 |
|---|---|
| Name | Robustaflavone |
| CAS RN | 49620-13-5 |
| Standard InChI | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)23-11-22(37)29-26(39-23)12-20(35)27(30(29)38)17-7-14(3-6-18(17)33)24-10-21(36)28-19(34)8-16(32)9-25(28)40-24/h1-12,31-35,38H |
| Standard InChI (Main Layer) | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)23-11-22(37)29-26(39-23)12-20(35)27(30(29)38)17-7-14(3-6-18(17)33)24-10-21(36)28-19(34)8-16(32)9-25(28)40-24/h1-12,31-35,38H |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 34 |
| By standard InChI | CHEMBL63677 |
|---|---|
| By standard InChI Main Layer | CHEMBL63677 |
| By LinkDB | C10179 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 4 |
| rosids | 2 |
| Embryophyta | 1 |
| family name | count |
|---|---|
| Cupressaceae | 2 |
| Anacardiaceae | 2 |
| Araucariaceae | 2 |
| Selaginellaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL63677 |
CHEMBL1211753
(1)
|
0 / 0 |
| P08253 | 72 kDa type IV collagenase | M10A | CHEMBL63677 |
CHEMBL945961
(1)
|
1 / 3 |