id | C00000115 |
---|---|
Name | Indol-3-propionic acid / 1H-Indole-3-propanoic acid |
CAS RN | 830-96-6 |
Standard InChI | InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14) |
Standard InChI (Main Layer) | InChI=1S/C11H11NO2/c13-11(14)6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6H2,(H,13,14) |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 1432 |
By standard InChI | CHEMBL207225 |
---|---|
By standard InChI Main Layer | CHEMBL207225 |
By LinkDB |
---|
By CAS RN | C015292 |
---|
class name | count |
---|---|
rosids | 2 |
family name | count |
---|---|
Fabaceae | 1 |
Cucurbitaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Cucurbita pepo | 3663 | Cucurbitaceae | rosids | Viridiplantae |
Pisum sativum | 3888 | Fabaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q16773 | Kynurenine--oxoglutarate transaminase 1 | Enzyme | CHEMBL207225 |
CHEMBL1002982
(1)
|
0 / 0 |