id | C00001204 |
---|---|
Name | Suberic acid |
CAS RN | 505-48-6 |
Standard InChI | InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
Standard InChI (Main Layer) | InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 1853 |
By standard InChI | CHEMBL1162491 |
---|---|
By standard InChI Main Layer | CHEMBL1162491 |
By LinkDB | C08278 |
---|
By CAS RN | C005738 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Euphorbiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Ricinus communis | 3988 | Euphorbiaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL1162491 |
CHEMBL1794399
(1)
|
3 / 1 |