| id | C00013350 |
|---|---|
| Name | Tetramethylkaempferol / O-Tetramethylkaempferol / 3,5,7,4'-Tetramethoxyflavone / 2-(4-Methoxyphenyl)-3,5,7-trimethoxy-4-oxo-4H-1-benzopyran / 3,5,7-Trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| CAS RN | 16692-52-7 |
| Standard InChI | InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)18-19(24-4)17(20)16-14(23-3)9-13(22-2)10-15(16)25-18/h5-10H,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)18-19(24-4)17(20)16-14(23-3)9-13(22-2)10-15(16)25-18/h5-10H,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL356036 |
|---|---|
| By standard InChI Main Layer | CHEMBL356036 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 2 |
| family name | count |
|---|---|
| Zingiberaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Amomum koenigii | 252851 | Zingiberaceae | Liliopsida | Viridiplantae |
| Kaempferia parviflora | 97751 | Zingiberaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL356036 |
CHEMBL638578
(1)
CHEMBL649050
(1)
|
0 / 0 |