| id | C00001353 |
|---|---|
| Name | L-alpha,gamma-Diaminobutyric acid |
| CAS RN | 1358-80-1 |
| Standard InChI | InChI=1S/C4H10N2O2/c5-2-1-3(6)4(7)8/h3H,1-2,5-6H2,(H,7,8)/t3-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C4H10N2O2/c5-2-1-3(6)4(7)8/h3H,1-2,5-6H2,(H,7,8) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1538 |
| By standard InChI | CHEMBL321357 |
|---|---|
| By standard InChI Main Layer | CHEMBL307931 CHEMBL102493 CHEMBL321357 |
| By LinkDB | C03283 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Fabaceae | 2 |
| Asparagaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acacia spp. | 3808 | Fabaceae | rosids | Viridiplantae |
| Lathyrus sylvestris | 313117 | Fabaceae | rosids | Viridiplantae |
| Polygonatum multiflorum | 45371 | Asparagaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL321357 |
CHEMBL1741321
(1)
|
1 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL321357 |
CHEMBL1741325
(1)
|
0 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL321357 |
CHEMBL1741322
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL321357 |
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL321357 |
CHEMBL1741324
(1)
|
0 / 1 |