| id | C00014196 |
|---|---|
| Name | (2S)-2'-Methoxykurarinone / (2S)-7,4'-Dihydroxy-8-lavandulyl-5,2'-dimethoxyflavanone |
| CAS RN | 270249-38-2 |
| Standard InChI | InChI=1S/C27H32O6/c1-15(2)7-8-17(16(3)4)11-20-21(29)13-25(32-6)26-22(30)14-24(33-27(20)26)19-10-9-18(28)12-23(19)31-5/h7,9-10,12-13,17,24,28-29H,3,8,11,14H2,1-2,4-6H3/t17-,24+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H32O6/c1-15(2)7-8-17(16(3)4)11-20-21(29)13-25(32-6)26-22(30)14-24(33-27(20)26)19-10-9-18(28)12-23(19)31-5/h7,9-10,12-13,17,24,28-29H,3,8,11,14H2,1-2,4-6H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 19 |
| By standard InChI | CHEMBL496451 |
|---|---|
| By standard InChI Main Layer | CHEMBL480469 CHEMBL496451 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Sophora flavescens | 49840 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL496451 |
CHEMBL946247
(1)
CHEMBL946248
(1)
CHEMBL946249 (2) |
0 / 0 |