| id | C00014483 |
|---|---|
| Name | Gemichalcone C / 3'-(4-Feruloyloxy-3-methylbutyl-2(Z)-enyl)-2,4,2',4'-tetrahydroxychalcone |
| CAS RN | 238750-50-0 |
| Standard InChI | InChI=1S/C30H28O9/c1-18(17-39-29(36)14-5-19-4-11-26(34)28(15-19)38-2)3-9-22-25(33)13-10-23(30(22)37)24(32)12-7-20-6-8-21(31)16-27(20)35/h3-8,10-16,31,33-35,37H,9,17H2,1-2H3/b12-7+,14-5+,18-3- |
| Standard InChI (Main Layer) | InChI=1S/C30H28O9/c1-18(17-39-29(36)14-5-19-4-11-26(34)28(15-19)38-2)3-9-22-25(33)13-10-23(30(22)37)24(32)12-7-20-6-8-21(31)16-27(20)35/h3-8,10-16,31,33-35,37H,9,17H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1706 |
| By standard InChI | CHEMBL499860 |
|---|---|
| By standard InChI Main Layer | CHEMBL463638 CHEMBL499860 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Moraceae | 1 |
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artocarpus communis | 194251 | Moraceae | rosids | Viridiplantae |
| Hypericum geminiflorum | 860794 | Hypericaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL463638 |
CHEMBL949646
(1)
|
2 / 2 |