id | C00015204 |
---|---|
Name | Combretastatin A1 / (Z)-3-Methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-1,2-benzenediol |
CAS RN | 109971-63-3 |
Standard InChI | InChI=1S/C18H20O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h5-10,19-20H,1-4H3/b6-5- |
Standard InChI (Main Layer) | InChI=1S/C18H20O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h5-10,19-20H,1-4H3 |
Phytochemical cluster | No. 13 |
---|---|
KCF-S cluster | No. 344 |
By standard InChI | CHEMBL36255 |
---|---|
By standard InChI Main Layer | CHEMBL36255 CHEMBL520204 |
By LinkDB |
---|
By CAS RN | C063690 |
---|
class name | count |
---|---|
rosids | 1 |
family name | count |
---|---|
Combretaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Combretum caffrum | 507393 | Combretaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P30874 | Somatostatin receptor type 2 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
P31391 | Somatostatin receptor type 4 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
P32745 | Somatostatin receptor type 3 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
P35346 | Somatostatin receptor type 5 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
P30872 | Somatostatin receptor type 1 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |