| id | C00015204 |
|---|---|
| Name | Combretastatin A1 / (Z)-3-Methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethenyl]-1,2-benzenediol |
| CAS RN | 109971-63-3 |
| Standard InChI | InChI=1S/C18H20O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h5-10,19-20H,1-4H3/b6-5- |
| Standard InChI (Main Layer) | InChI=1S/C18H20O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h5-10,19-20H,1-4H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 344 |
| By standard InChI | CHEMBL36255 |
|---|---|
| By standard InChI Main Layer | CHEMBL36255 CHEMBL520204 |
| By LinkDB |
|---|
| By CAS RN | C063690 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Combretaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Combretum caffrum | 507393 | Combretaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P30874 | Somatostatin receptor type 2 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
| P31391 | Somatostatin receptor type 4 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
| P32745 | Somatostatin receptor type 3 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
| P35346 | Somatostatin receptor type 5 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |
| P30872 | Somatostatin receptor type 1 | Somatostatin receptor | CHEMBL36255 |
CHEMBL700688
(1)
|
0 / 0 |