| id | C00015257 |
|---|---|
| Name | 2,7-Dihydroxy-3,4,6-trimethoxyphenanthrene |
| CAS RN | 39499-89-3 |
| Standard InChI | InChI=1S/C17H16O5/c1-20-14-8-11-9(6-12(14)18)4-5-10-7-13(19)16(21-2)17(22-3)15(10)11/h4-8,18-19H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H16O5/c1-20-14-8-11-9(6-12(14)18)4-5-10-7-13(19)16(21-2)17(22-3)15(10)11/h4-8,18-19H,1-3H3 |
| Phytochemical cluster | No. 27 |
|---|---|
| KCF-S cluster | No. 104 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Combretaceae | 1 |
| Orchidaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bulbophyllum reptans | 1097178 | Orchidaceae | Liliopsida | Viridiplantae |
| Combretum psidioides | 507422 | Combretaceae | rosids | Viridiplantae |