| id | C00015543 |
|---|---|
| Name | 4,7-Dihydroxy-2,3-dimethoxyphenanthrene |
| CAS RN | 40419-20-3 |
| Standard InChI | InChI=1S/C16H14O4/c1-19-13-8-10-4-3-9-7-11(17)5-6-12(9)14(10)15(18)16(13)20-2/h3-8,17-18H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H14O4/c1-19-13-8-10-4-3-9-7-11(17)5-6-12(9)14(10)15(18)16(13)20-2/h3-8,17-18H,1-2H3 |
| Phytochemical cluster | No. 27 |
|---|---|
| KCF-S cluster | No. 104 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Dioscoreaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Tamus communis | 55634 | Dioscoreaceae | Liliopsida | Viridiplantae |