| id | C00015608 |
|---|---|
| Name | 6,7-Dihydroxy-2,3,4-trimethoxyphenanthrene |
| CAS RN | 35450-76-1 |
| Standard InChI | InChI=1S/C17H16O5/c1-20-14-7-10-5-4-9-6-12(18)13(19)8-11(9)15(10)17(22-3)16(14)21-2/h4-8,18-19H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H16O5/c1-20-14-7-10-5-4-9-6-12(18)13(19)8-11(9)15(10)17(22-3)16(14)21-2/h4-8,18-19H,1-3H3 |
| Phytochemical cluster | No. 27 |
|---|---|
| KCF-S cluster | No. 104 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 3 |
| family name | count |
|---|---|
| Combretaceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Combretum hereroense | 493959 | Combretaceae | rosids | Viridiplantae |
| Combretum molle | 507414 | Combretaceae | rosids | Viridiplantae |
| Combretum psidioides | 507422 | Combretaceae | rosids | Viridiplantae |