| id | C00001575 | 
|---|---|
| Name | Lycoricidine | 
| CAS RN | 19622-83-4 | 
| Standard InChI | InChI=1S/C14H13NO6/c16-8-1-6-5-2-9-10(21-4-20-9)3-7(5)14(19)15-11(6)13(18)12(8)17/h1-3,8,11-13,16-18H,4H2,(H,15,19)/t8-,11+,12+,13-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C14H13NO6/c16-8-1-6-5-2-9-10(21-4-20-9)3-7(5)14(19)15-11(6)13(18)12(8)17/h1-3,8,11-13,16-18H,4H2,(H,15,19) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4581 | 
| By standard InChI | CHEMBL487798 | 
|---|---|
| By standard InChI Main Layer | CHEMBL487798 CHEMBL1728514 | 
| By LinkDB | C08531 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 2 | 
| family name | count | 
|---|---|
| Amaryllidaceae | 2 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lycoris radiata | 228395 | Amaryllidaceae | Liliopsida | Viridiplantae | 
| Lycoris sanguinea | 108053 | Amaryllidaceae | Liliopsida | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1728514 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1728514 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL1728514 | CHEMBL2114843
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1728514 | CHEMBL2114788
                        (1) | 0 / 0 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL1728514 | CHEMBL1794569
                        (1) | 1 / 1 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1728514 | CHEMBL1794483
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1728514 | CHEMBL1738184
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL1728514 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q06710 | Paired box protein Pax-8 | Unclassified protein | CHEMBL1728514 | CHEMBL2354301
                        (1) | 1 / 2 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #114500 | Colorectal cancer; crc | P84022 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #218700 | Hypothyroidism, congenital, nongoitrous, 2; chng2 | Q06710 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #278750 | Xeroderma pigmentosum, variant type; xpv | Q9Y253 |