| id | C00018753 | 
|---|---|
| Name | MPA / Melbex / NSC 129185 / Lilly 68618 / Mycophenolic acid | 
| CAS RN | 24280-93-1 | 
| Standard InChI | InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+ | 
| Standard InChI (Main Layer) | InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5526 | 
| By standard InChI | CHEMBL866 | 
|---|---|
| By standard InChI Main Layer | CHEMBL866 | 
| By LinkDB | 
|---|
| By CAS RN | D009173 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Aspergillaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Penicillium brevicompactum | 5074 | Aspergillaceae | Fungi | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL866 | CHEMBL1741321
                        (2)
                        CHEMBL1909136
                        (2) | 1 / 0 | 
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL866 | CHEMBL1614260
                        (4)
                        CHEMBL1613842
                        (3) | 4 / 2 | 
| Q9HAW8 | UDP-glucuronosyltransferase 1-10 | Enzyme | CHEMBL866 | CHEMBL1743331
                        (1)
                        CHEMBL1908087
                        (1) CHEMBL1908114 (4) | 0 / 0 | 
| P20839 | Inosine-5'-monophosphate dehydrogenase 1 | Oxidoreductase | CHEMBL866 | CHEMBL699983
                        (1)
                        CHEMBL697169
                        (1) CHEMBL698514 (1) CHEMBL698515 (1) CHEMBL698516 (1) CHEMBL845493 (1) CHEMBL865551 (1) CHEMBL865553 (1) CHEMBL901580 (1) CHEMBL902633 (1) CHEMBL981157 (1) CHEMBL998516 (1) CHEMBL1292995 (1) CHEMBL1685945 (1) | 2 / 2 | 
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL866 | CHEMBL1909139
                        (2) | 0 / 0 | 
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL866 | CHEMBL1909131
                        (2) | 0 / 3 | 
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL866 | CHEMBL1909190
                        (2) | 2 / 2 | 
| P08246 | Neutrophil elastase | S1A | CHEMBL866 | CHEMBL1909195
                        (2) | 2 / 1 | 
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL866 | CHEMBL1909215
                        (2) | 0 / 0 | 
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL866 | CHEMBL1909201
                        (2) | 0 / 0 | 
| P49146 | Neuropeptide Y receptor type 2 | Neuropeptide Y receptor | CHEMBL866 | CHEMBL1909176
                        (2) | 0 / 0 | 
| P29466 | Caspase-1 | C14 | CHEMBL866 | CHEMBL1909193
                        (2) | 0 / 0 | 
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL866 | CHEMBL1909198
                        (2) | 0 / 0 | 
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL866 | CHEMBL1909199
                        (2) | 0 / 0 | 
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL866 | CHEMBL1909197
                        (2) | 2 / 2 | 
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL866 | CHEMBL1614544
                        (1)
                        CHEMBL1614073
                        (1) | 11 / 10 | 
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL866 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P12268 | Inosine-5'-monophosphate dehydrogenase 2 | Oxidoreductase | CHEMBL866 | CHEMBL699983
                        (1)
                        CHEMBL699984
                        (1) CHEMBL698524 (1) CHEMBL698525 (1) CHEMBL697550 (1) CHEMBL698781 (1) CHEMBL699556 (1) CHEMBL699557 (1) CHEMBL699558 (1) CHEMBL699559 (1) CHEMBL699561 (1) CHEMBL699564 (1) CHEMBL699565 (1) CHEMBL865552 (1) CHEMBL865553 (1) CHEMBL889231 (1) CHEMBL901581 (1) CHEMBL902634 (1) CHEMBL981158 (1) CHEMBL998517 (1) CHEMBL1292996 (1) CHEMBL1685943 (1) CHEMBL1936596 (1) CHEMBL2020803 (1) | 0 / 0 | 
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL866 | CHEMBL1909123
                        (2) | 1 / 2 | 
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL866 | CHEMBL1909092
                        (2) | 0 / 1 | 
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL866 | CHEMBL1909169
                        (2) | 1 / 1 | 
| P25021 | Histamine H2 receptor | Histamine receptor | CHEMBL866 | CHEMBL1909157
                        (2) | 0 / 0 | 
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL866 | CHEMBL1909156
                        (2) | 0 / 0 | 
| Q01959 | Sodium-dependent dopamine transporter | Dopamine | CHEMBL866 | CHEMBL1909143
                        (2) | 1 / 0 | 
| P08912 | Muscarinic acetylcholine receptor M5 | Acetylcholine receptor | CHEMBL866 | CHEMBL1909174
                        (2) | 0 / 0 | 
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL866 | CHEMBL1909090
                        (2) | 0 / 0 | 
| P13945 | Beta-3 adrenergic receptor | Adrenergic receptor | CHEMBL866 | CHEMBL1909093
                        (2) | 0 / 0 | 
| P25024 | C-X-C chemokine receptor type 1 | CXC chemokine receptor | CHEMBL866 | CHEMBL1909127
                        (2) | 0 / 0 | 
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL866 | CHEMBL1909204
                        (2) | 0 / 0 | 
| Q08209 | Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform | Ser_Thr | CHEMBL866 | CHEMBL1909202
                        (2) | 0 / 0 | 
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL866 | CHEMBL1741325
                        (2)
                        CHEMBL1909135
                        (2) | 0 / 1 | 
| Q9HAW7 | UDP-glucuronosyltransferase 1-7 | Enzyme | CHEMBL866 | CHEMBL1743328
                        (1)
                        CHEMBL1908118
                        (2) | 0 / 0 | 
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL866 | CHEMBL1909203
                        (2) | 1 / 11 | 
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL866 | CHEMBL1909140
                        (2) | 2 / 0 | 
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL866 | CHEMBL1909130
                        (2) | 0 / 0 | 
| P37288 | Vasopressin V1a receptor | Vasopressin and oxytocin receptor | CHEMBL866 | CHEMBL1909120
                        (2) | 0 / 0 | 
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL866 | CHEMBL1909181
                        (2) | 0 / 0 | 
| Q9Y271 | Cysteinyl leukotriene receptor 1 | Leukotriene receptor | CHEMBL866 | CHEMBL1909164
                        (2) | 0 / 0 | 
| P29274 | Adenosine receptor A2a | Adenosine receptor | CHEMBL866 | CHEMBL1909214
                        (2) | 0 / 0 | 
| P25929 | Neuropeptide Y receptor type 1 | Neuropeptide Y receptor | CHEMBL866 | CHEMBL1909175
                        (2) | 0 / 0 | 
| P50052 | Type-2 angiotensin II receptor | Angiotensin receptor | CHEMBL866 | CHEMBL1909096
                        (2) | 1 / 1 | 
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL866 | CHEMBL1909118
                        (2) | 0 / 0 | 
| P41968 | Melanocortin receptor 3 | Melanocortin receptor | CHEMBL866 | CHEMBL1909166
                        (2) | 1 / 0 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL866 | CHEMBL1614458
                        (2) | 0 / 0 | 
| P11509 | Cytochrome P450 2A6 | Cytochrome P450 2A6 | CHEMBL866 | CHEMBL1909133
                        (2) | 0 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL866 | CHEMBL2114843
                        (1) | 0 / 0 | 
| O60656 | UDP-glucuronosyltransferase 1-9 | Enzyme | CHEMBL866 | CHEMBL1908120
                        (2) | 0 / 0 | 
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL866 | CHEMBL1909158
                        (2) | 0 / 0 | 
| P08913 | Alpha-2A adrenergic receptor | Adrenergic receptor | CHEMBL866 | CHEMBL1909088
                        (2) | 0 / 0 | 
| P21917 | D(4) dopamine receptor | Dopamine receptor | CHEMBL866 | CHEMBL1909142
                        (2) | 0 / 0 | 
| P30988 | Calcitonin receptor | Calcitonin receptor | CHEMBL866 | CHEMBL1909101
                        (2) | 0 / 0 | 
| P35462 | D(3) dopamine receptor | Dopamine receptor | CHEMBL866 | CHEMBL1909141
                        (2) | 1 / 0 | 
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL866 | CHEMBL1909180
                        (2) | 0 / 0 | 
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL866 | CHEMBL1909146
                        (2) | 0 / 1 | 
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL866 | CHEMBL1909104
                        (2) | 0 / 0 | 
| P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL866 | CHEMBL1909144
                        (2) | 0 / 0 | 
| P30411 | B2 bradykinin receptor | Bradykinin receptor | CHEMBL866 | CHEMBL1909100
                        (2) | 0 / 0 | 
| P32245 | Melanocortin receptor 4 | Melanocortin receptor | CHEMBL866 | CHEMBL1909167
                        (2) | 1 / 0 | 
| P32238 | Cholecystokinin receptor type A | Cholecystokinin receptor | CHEMBL866 | CHEMBL1909129
                        (2) | 0 / 0 | 
| P08311 | Cathepsin G | S1A | CHEMBL866 | CHEMBL1909194
                        (2) | 0 / 0 | 
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL866 | CHEMBL1909110
                        (2) | 1 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL866 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P03956 | Interstitial collagenase | M10A | CHEMBL866 | CHEMBL1909196
                        (2) | 0 / 1 | 
| P32241 | Vasoactive intestinal polypeptide receptor 1 | Vasoactive intestinal peptide receptor | CHEMBL866 | CHEMBL1909119
                        (2) | 0 / 0 | 
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL866 | CHEMBL1909150
                        (2) | 0 / 1 | 
| P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL866 | CHEMBL1909171
                        (2) | 2 / 0 | 
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL866 | CHEMBL1909170
                        (2) | 0 / 0 | 
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL866 | CHEMBL1909122
                        (2) | 0 / 0 | 
| P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL866 | CHEMBL1909109
                        (2) | 2 / 0 | 
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL866 | CHEMBL897826
                        (1)
                        CHEMBL897827
                        (1) CHEMBL897828 (1) CHEMBL897829 (1) | 5 / 3 | 
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL866 | CHEMBL1909205
                        (2) | 5 / 10 | 
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL866 | CHEMBL1909172
                        (2) | 1 / 0 | 
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL866 | CHEMBL1909114
                        (2) | 0 / 0 | 
| P51679 | C-C chemokine receptor type 4 | CC chemokine receptor | CHEMBL866 | CHEMBL1909125
                        (2) | 0 / 0 | 
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL866 | CHEMBL1909126
                        (2) | 3 / 0 | 
| P50406 | 5-hydroxytryptamine receptor 6 | Serotonin receptor | CHEMBL866 | CHEMBL1909108
                        (2) | 0 / 0 | 
| P41597 | C-C chemokine receptor type 2 | CC chemokine receptor | CHEMBL866 | CHEMBL1909124
                        (2) | 1 / 0 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL866 | CHEMBL1909200
                        (2) | 0 / 0 | 
| P08575 | Receptor-type tyrosine-protein phosphatase C | Enzyme | CHEMBL866 | CHEMBL1909207
                        (2) | 2 / 1 | 
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL866 | CHEMBL1741322
                        (2)
                        CHEMBL1909132
                        (2) | 0 / 0 | 
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL866 | CHEMBL1613910
                        (2)
                        CHEMBL1614227
                        (1) | 3 / 3 | 
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL866 | CHEMBL1614038
                        (4) | 2 / 2 | 
| Q9HAW9 | UDP-glucuronosyltransferase 1-8 | Enzyme | CHEMBL866 | CHEMBL1743329
                        (1)
                        CHEMBL1908085
                        (1) CHEMBL1908119 (2) | 0 / 0 | 
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL866 | CHEMBL1909186
                        (2) | 0 / 0 | 
| P03372 | Estrogen receptor | NR3A1 | CHEMBL866 | CHEMBL1909145
                        (2) | 1 / 1 | 
| P08588 | Beta-1 adrenergic receptor | Adrenergic receptor | CHEMBL866 | CHEMBL1909091
                        (2) | 1 / 0 | 
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL866 | CHEMBL1909212
                        (2) | 1 / 0 | 
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL866 | CHEMBL1909211
                        (2) | 0 / 0 | 
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL866 | CHEMBL1909105
                        (2) | 0 / 0 | 
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL866 | CHEMBL1909182
                        (2) | 0 / 0 | 
| P08173 | Muscarinic acetylcholine receptor M4 | Acetylcholine receptor | CHEMBL866 | CHEMBL1909173
                        (2) | 0 / 0 | 
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL866 | CHEMBL1909113
                        (2) | 0 / 0 | 
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL866 | CHEMBL1909187
                        (2) | 0 / 0 | 
| P33032 | Melanocortin receptor 5 | Melanocortin receptor | CHEMBL866 | CHEMBL1909168
                        (2) | 0 / 0 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL866 | CHEMBL1741323
                        (2)
                        CHEMBL1909134
                        (2) | 1 / 1 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL866 | CHEMBL1614108
                        (2)
                        CHEMBL1613886
                        (2) CHEMBL1741324 (2) CHEMBL1909138 (2) | 0 / 1 | 
| P05181 | Cytochrome P450 2E1 | Cytochrome P450 2E1 | CHEMBL866 | CHEMBL1909137
                        (2) | 0 / 0 | 
| P22309 | UDP-glucuronosyltransferase 1-1 | Enzyme | CHEMBL866 | CHEMBL1908113
                        (2) | 5 / 1 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL866 | CHEMBL1738184
                        (1) | 0 / 0 | 
| P23975 | Sodium-dependent noradrenaline transporter | Norepinephrine | CHEMBL866 | CHEMBL1909094
                        (2) | 1 / 1 | 
| P25100 | Alpha-1D adrenergic receptor | Adrenergic receptor | CHEMBL866 | CHEMBL1909087
                        (2) | 0 / 0 | 
| P30542 | Adenosine receptor A1 | Adenosine receptor | CHEMBL866 | CHEMBL1909213
                        (2) | 0 / 0 | 
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL866 | CHEMBL1909089
                        (2) | 0 / 0 | 
| P24557 | Thromboxane-A synthase | Cytochrome P450 5A1 | CHEMBL866 | CHEMBL1909116
                        (2) | 1 / 1 | 
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL866 | CHEMBL1909206
                        (2) | 0 / 1 | 
| P25025 | C-X-C chemokine receptor type 2 | CXC chemokine receptor | CHEMBL866 | CHEMBL1909128
                        (2) | 0 / 0 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL866 | CHEMBL1613914
                        (4) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL866 | CHEMBL1738442
                        (1) | 0 / 0 | 
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL866 | CHEMBL1613933
                        (1) | 0 / 1 | 
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL866 | CHEMBL1613933
                        (1) | 1 / 6 | 
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL866 | CHEMBL2354287
                        (1) | 1 / 1 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| D009173 | 207 | AKT1 AKT CWS6 PKB PKB-ALPHA PRKBA RAC RAC-ALPHA | v-akt murine thymoma viral oncogene homolog 1 (EC:2.7.11.1) | Mycophenolic Acid results in increased expression of AKT1 protein | increases expression | protein | 21396949 | 
| D009173 | 466 | ATF1 EWS-ATF1 FUS/ATF-1 TREB36 | activating transcription factor 1 | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of ATF1 protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 581 | BAX BCL2L4 | BCL2-associated X protein | [Mycophenolic Acid co-treated with Hypoxanthine] results in increased expression of BAX protein | affects cotreatment / increases expression | protein | 21396949 | 
| D009173 | 596 | BCL2 Bcl-2 PPP1R50 | B-cell CLL/lymphoma 2 | [Mycophenolic Acid co-treated with Hypoxanthine] results in decreased expression of BCL2 protein | affects cotreatment / decreases expression | protein | 21396949 | 
| D009173 | 836 | CASP3 CPP32 CPP32B SCA-1 | caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | [Mycophenolic Acid co-treated with Hypoxanthine] results in increased activity of CASP3 protein | affects cotreatment / increases activity | protein | 21396949 | 
| D009173 | 836 | CASP3 CPP32 CPP32B SCA-1 | caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | Mycophenolic Acid results in increased activity of CASP3 protein | increases activity | protein | 16059982 | 
| D009173 | 1027 | CDKN1B CDKN4 KIP1 MEN1B MEN4 P27KIP1 | cyclin-dependent kinase inhibitor 1B (p27, Kip1) | Mycophenolic Acid inhibits the reaction [IL2 protein results in decreased expression of CDKN1B protein] | decreases expression / decreases reaction | protein | 12193749 | 
| D009173 | 1385 | CREB1 CREB | cAMP responsive element binding protein 1 | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of CREB1 protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 1558 | CYP2C8 CPC8 CYPIIC8 MP-12/MP-20 | cytochrome P450, family 2, subfamily C, polypeptide 8 (EC:1.14.14.1) | CYP2C8 protein results in increased methylation of Mycophenolic Acid | increases methylation | protein | 15570183 | 
| D009173 | 1576 | CYP3A4 CP33 CP34 CYP3A CYP3A3 CYPIIIA3 CYPIIIA4 HLP NF-25 P450C3 P450PCN1 | cytochrome P450, family 3, subfamily A, polypeptide 4 (EC:1.14.13.67 1.14.13.97 1.14.13.32 1.14.13.157) | CYP3A4 protein results in increased methylation of Mycophenolic Acid | increases methylation | protein | 15570183 | 
| D009173 | 1577 | CYP3A5 CP35 CYPIIIA5 P450PCN3 PCN3 | cytochrome P450, family 3, subfamily A, polypeptide 5 (EC:1.14.14.1) | CYP3A5 protein results in increased methylation of Mycophenolic Acid | increases methylation | protein | 15570183 | 
| D009173 | 2353 | FOS AP-1 C-FOS p55 | FBJ murine osteosarcoma viral oncogene homolog | Mycophenolic Acid results in increased expression of FOS mRNA | increases expression | mRNA | 12730611 | 
| D009173 | 2932 | GSK3B | glycogen synthase kinase 3 beta (EC:2.7.11.1 2.7.11.26) | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of GSK3B protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 3558 | IL2 IL-2 TCGF lymphokine | interleukin 2 | Mycophenolic Acid inhibits the reaction [IL2 protein results in decreased expression of CDKN1B protein] | decreases expression / decreases reaction | protein | 12193749 | 
| D009173 | 3576 | IL8 CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 | interleukin 8 | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased secretion of IL8 protein] | decreases reaction / increases secretion | protein | 20302854 | 
| D009173 | 22914 | KLRK1 CD314 D12S2489E KLR NKG2-D NKG2D | killer cell lectin-like receptor subfamily K, member 1 | Mycophenolic Acid results in decreased expression of KLRK1 | decreases expression | 20736080 | |
| D009173 | 4067 | LYN JTK8 p53Lyn p56Lyn | v-yes-1 Yamaguchi sarcoma viral related oncogene homolog (EC:2.7.10.2) | [Mycophenolic Acid co-treated with imatinib] results in decreased phosphorylation of LYN protein | affects cotreatment / decreases phosphorylation | protein | 15604220 | 
| D009173 | 5594 | MAPK1 ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk | mitogen-activated protein kinase 1 (EC:2.7.11.24) | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of MAPK1 protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 5594 | MAPK1 ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk | mitogen-activated protein kinase 1 (EC:2.7.11.24) | Mycophenolic Acid results in decreased expression of MAPK1 protein modified form | decreases expression | protein | 20302854 | 
| D009173 | 5595 | MAPK3 ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK | mitogen-activated protein kinase 3 (EC:2.7.11.24) | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of MAPK3 protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 5595 | MAPK3 ERK-1 ERK1 ERT2 HS44KDAP HUMKER1A P44ERK1 P44MAPK PRKM3 p44-ERK1 p44-MAPK | mitogen-activated protein kinase 3 (EC:2.7.11.24) | Mycophenolic Acid results in decreased expression of MAPK3 protein modified form | decreases expression | protein | 20302854 | 
| D009173 | 5599 | MAPK8 JNK JNK-46 JNK1 JNK1A2 JNK21B1/2 PRKM8 SAPK1 SAPK1c | mitogen-activated protein kinase 8 (EC:2.7.11.24) | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of MAPK8 protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 5601 | MAPK9 JNK-55 JNK2 JNK2A JNK2ALPHA JNK2B JNK2BETA PRKM9 SAPK SAPK1a p54a p54aSAPK | mitogen-activated protein kinase 9 (EC:2.7.11.24) | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of MAPK9 protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 4137 | MAPT DDPAC FTDP-17 MAPTL MSTD MTBT1 MTBT2 PPND TAU | microtubule-associated protein tau | Mycophenolic Acid results in decreased expression of MAPT protein | decreases expression | protein | 16930453 | 
| D009173 | 9437 | NCR1 CD335 LY94 NK-p46 NKP46 | natural cytotoxicity triggering receptor 1 | Mycophenolic Acid results in decreased expression of NCR1 | decreases expression | 20736080 | |
| D009173 | 9436 | NCR2 CD336 LY95 NK-p44 NKP44 dJ149M18.1 | natural cytotoxicity triggering receptor 2 | Mycophenolic Acid results in decreased expression of NCR2 | decreases expression | 20736080 | |
| D009173 | 259197 | NCR3 1C7 CD337 LY117 MALS NKp30 | natural cytotoxicity triggering receptor 3 | Mycophenolic Acid results in decreased expression of NCR3 | decreases expression | 20736080 | |
| D009173 | 5578 | PRKCA AAG6 PKC-alpha PKCA PRKACA | protein kinase C, alpha (EC:2.7.11.13) | Mycophenolic Acid results in increased expression of PRKCA protein | increases expression | protein | 21396949 | 
| D009173 | 5970 | RELA NFKB3 p65 | v-rel avian reticuloendotheliosis viral oncogene homolog A | Mycophenolic Acid inhibits the reaction [Hydrogen Peroxide results in increased phosphorylation of RELA protein] | decreases reaction / increases phosphorylation | protein | 20302854 | 
| D009173 | 6194 | RPS6 S6 | ribosomal protein S6 | [Mycophenolic Acid co-treated with imatinib] results in decreased phosphorylation of RPS6 protein | affects cotreatment / decreases phosphorylation | protein | 15604220 | 
| D009173 | 6776 | STAT5A MGF STAT5 | signal transducer and activator of transcription 5A | [Mycophenolic Acid co-treated with imatinib] results in decreased phosphorylation of STAT5A protein | affects cotreatment / decreases phosphorylation | protein | 15604220 | 
| D009173 | 54600 | UGT1A9 HLUGP4 LUGP4 UDPGT UDPGT_1-9 UGT-1I UGT1-09 UGT1-9 UGT1.9 UGT1AI UGT1I | UDP glucuronosyltransferase 1 family, polypeptide A9 (EC:2.4.1.17) | UGT1A9 gene SNP affects the metabolism of Mycophenolic Acid | affects metabolic processing | gene | 18498916 | 
| D009173 | 54600 | UGT1A9 HLUGP4 LUGP4 UDPGT UDPGT_1-9 UGT-1I UGT1-09 UGT1-9 UGT1.9 UGT1AI UGT1I | UDP glucuronosyltransferase 1 family, polypeptide A9 (EC:2.4.1.17) | UGT1A9 protein results in increased glucuronidation of Mycophenolic Acid | increases glucuronidation | protein | 18816295 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency | Q99714 | 
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism | P20309 | 
| #103780 | Alcohol dependence | P08172 P14416 P31645 | 
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 | Q13148 | 
| #614373 | Amyotrophic lateral sclerosis 16, juvenile; als16 | Q99720 | 
| #601816 | Bilirubin, serum level of, quantitative trait locus 1; biliqtl1 | P22309 | 
| #602025 | Body mass index quantitative trait locus 9; bmiq9 | P41968 | 
| %606641 | Body mass index; bmi | P37231 | 
| #300615 | Brunner syndrome | P21397 | 
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a | P02545 | 
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism | P02545 | 
| #609338 | Carotid intimal medial thickness 1 | P37231 | 
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 | P02545 | 
| #218800 | Crigler-najjar syndrome, type i | P22309 | 
| #606785 | Crigler-najjar syndrome, type ii | P22309 | 
| #162800 | Cyclic neutropenia | P08246 | 
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #612522 | Diabetes mellitus, insulin-dependent, 22; iddm22 | P51681 | 
| #119900 | Digital clubbing, isolated congenital | P15428 | 
| #609535 | Drug metabolism, poor, cyp2c19-related | P33261 | 
| #608902 | Drug metabolism, poor, cyp2d6-related | P10635 | 
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 | P02545 | 
| #615363 | Estrogen resistance; estrr | P03372 | 
| #613659 | Gastric cancer | P04626 | 
| #137215 | Gastric cancer, hereditary diffuse; hdgc | P04626 | 
| #231095 | Ghosal hematodiaphyseal dysplasia; ghdd | P24557 | 
| #143500 | Gilbert syndrome | P22309 | 
| #137800 | Glioma susceptibility 1; glm1 | P04626 P37231 | 
| #610140 | Heart-hand syndrome, slovenian type | P02545 | 
| #609423 | Human immunodeficiency virus type 1, susceptibility to | P41597 P51681 | 
| #176670 | Hutchinson-gilford progeria syndrome; hgps | P02545 | 
| #237900 | Hyperbilirubinemia, transient familial neonatal; hblrtfn | P22309 | 
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 | P15428 | 
| #603932 | Intervertebral disc disease; idd | P14780 | 
| #613837 | Leber congenital amaurosis 11; lca11 | P20839 | 
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 | P02545 | 
| #604367 | Lipodystrophy, familial partial, type 3; fpld3 | P37231 | 
| #613688 | Long qt syndrome 2; lqt2 | Q12809 | 
| #211980 | Lung cancer | P00533 P04626 | 
| #608516 | Major depressive disorder; mdd | P08172 | 
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada | P02545 | 
| #300705 | Mental retardation, x-linked 17; mrx17 | Q99714 | 
| %300852 | Mental retardation, x-linked 88; mrx88 | P50052 | 
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 | Q99714 | 
| #613073 | Metaphyseal anadysplasia 2; mandp2 | P14780 | 
| #126200 | Multiple sclerosis, susceptibility to; ms | P08575 | 
| #613205 | Muscular dystrophy, congenital, lmna-related | P02545 | 
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b | P02545 | 
| #159900 | Myoclonic dystonia | P14416 | 
| #202700 | Neutropenia, severe congenital, 1, autosomal dominant; scn1 | P08246 | 
| #601665 | Obesity | P32245 P37231 | 
| #164230 | Obsessive-compulsive disorder; ocd | P31645 | 
| #604715 | Orthostatic intolerance | P23975 | 
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 | P00918 | 
| #167000 | Ovarian cancer | P04626 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| #613135 | Parkinsonism-dystonia, infantile; pkdys | Q01959 | 
| #601399 | Platelet disorder, familial, with associated myeloid malignancy | Q01196 | 
| #607276 | Resting heart rate, variation in | P08588 | 
| #275210 | Restrictive dermopathy, lethal | P02545 | 
| #180105 | Retinitis pigmentosa 10; rp10 | P20839 | 
| #608971 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-positive | P08575 | 
| #609620 | Short qt syndrome 1; sqt1 | Q12809 | 
| #253300 | Spinal muscular atrophy, type i; sma1 | Q16637 | 
| #253550 | Spinal muscular atrophy, type ii; sma2 | Q16637 | 
| #253400 | Spinal muscular atrophy, type iii; sma3 | Q16637 | 
| #271150 | Spinal muscular atrophy, type iv; sma4 | Q16637 | 
| #190300 | Tremor, hereditary essential, 1; etm1 | P35462 | 
| #610379 | West nile virus, susceptibility to | P51681 | 
| #112100 | Yt blood group antigen | P22303 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00016 | Oral cancer | P00533
                            (related) P00533 (marker) | 
| H00017 | Esophageal cancer | P00533
                            (related) P35354 (related) | 
| H00018 | Gastric cancer | P00533
                            (related) P04626 (related) | 
| H00022 | Bladder cancer | P00533
                            (related) P04626 (related) | 
| H00028 | Choriocarcinoma | P00533
                            (related) P03956 (related) P04626 (related) | 
| H00030 | Cervical cancer | P00533
                            (related) P04626 (related) | 
| H00042 | Glioma | P00533
                            (related) P00533 (marker) | 
| H00055 | Laryngeal cancer | P00533
                            (related) P00533 (marker) | 
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) | P00918
                            (related) | 
| H00436 | Osteopetrosis | P00918
                            (related) | 
| H00264 | Charcot-Marie-Tooth disease (CMT) | P02545
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | P02545
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P02545
                            (related) P37231 (related) | 
| H00563 | Emery-Dreifuss muscular dystrophy | P02545
                            (related) | 
| H00590 | Congenital muscular dystrophies (CMD/MDC) | P02545
                            (related) | 
| H00593 | Limb-girdle muscular dystrophy (LGMD) | P02545
                            (related) | 
| H00601 | Hutchinson-Gilford progeria syndrome | P02545
                            (related) | 
| H00663 | Restrictive dermopathy | P02545
                            (related) | 
| H00665 | Mandibuloacral dysplasia | P02545
                            (related) | 
| H01216 | Left ventricular noncompaction (LVNC) | P02545
                            (related) | 
| H00026 | Endometrial Cancer | P03372
                            (marker) P04626 (related) Q92731 (marker) | 
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) | P04150
                            (related) | 
| H00019 | Pancreatic cancer | P04626
                            (related) | 
| H00027 | Ovarian cancer | P04626
                            (related) | 
| H00031 | Breast cancer | P04626
                            (related) P04626 (marker) | 
| H00046 | Cholangiocarcinoma | P04626
                            (related) P35354 (related) | 
| H00093 | Combined immunodeficiencies (CIDs) | P06239
                            (related) | 
| H00079 | Asthma | P07550
                            (related) | 
| H00100 | Neutropenic disorders | P08246
                            (related) | 
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) | P08575
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H01205 | Coumarin resistance | P11712
                            (related) | 
| H00025 | Penile cancer | P14780
                            (related) P35354 (related) | 
| H00479 | Metaphyseal dysplasias | P14780
                            (related) | 
| H00457 | Primary hypertrophic osteoarthropathy (PHO) | P15428
                            (related) | 
| H01246 | Isolated congenital nail clubbing (ICNC) | P15428
                            (related) | 
| H00527 | Retinitis pigmentosa (RP) | P20839
                            (related) | 
| H00837 | Leber congenital amaurosis (LCR) | P20839
                            (related) | 
| H00548 | Brunner syndrome | P21397
                            (related) | 
| H00208 | Hyperbilirubinemia | P22309
                            (related) | 
| H01031 | Orthostatic intolerance (OI) | P23975
                            (related) | 
| H00490 | Diaphyseal dysplasia with anemia (Ghosal) | P24557
                            (related) | 
| H01171 | Poor drug metabolism (PM) | P33261
                            (related) | 
| H00032 | Thyroid cancer | P37231
                            (related) | 
| H00409 | Type II diabetes mellitus | P37231
                            (related) | 
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00480 | Non-syndromic X-linked mental retardation | P50052
                            (related) Q99714 (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q01196
                            (related) Q01196 (marker) | 
| H00003 | Acute myeloid leukemia (AML) | Q01196
                            (related) Q01196 (marker) Q13951 (marker) | 
| H00004 | Chronic myeloid leukemia (CML) | Q01196
                            (related) | 
| H00978 | Thrombocytopenia (THC) | Q01196
                            (related) | 
| H00720 | Long QT syndrome | Q12809
                            (related) | 
| H00725 | Short QT syndrome | Q12809
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | Q13148
                            (related) | 
| H00455 | Spinal muscular atrophy (SMA) | Q16637
                            (related) Q16637 (related) | 
| H00658 | Syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency | Q99714
                            (related) | 
| MeSH disease | OMIM | compound | disease name | evidence type | reference pmid | 
|---|---|---|---|---|---|
| D000740 | D009173 | Anemia | marker/mechanism | 17318074 | |
| D005767 | D009173 | Gastrointestinal Diseases | marker/mechanism | 17318074 | |
| D006086 | D009173 | Graft vs Host Disease | therapeutic | 20736080 | |
| D006526 | D009173 | Hepatitis C | therapeutic | 12781720 | |
| D007249 | D009173 | Inflammation | marker/mechanism | 19818335 | |
| D007968 | D009173 | Leukoencephalopathy, Progressive Multifocal | marker/mechanism | 20657885 | |
| D007970 | D009173 | Leukopenia | marker/mechanism | 17318074 | |
| D055953 | D009173 | Microscopic Polyangiitis | therapeutic | 19184066 | |
| D009336 | D009173 | Necrosis | marker/mechanism | 19430526 | |
| D009421 | D009173 | Nervous System Malformations | marker/mechanism | 22914985 | |
| D014890 | D009173 | Wegener Granulomatosis | therapeutic | 19184066 |