| id | C00001891 | 
|---|---|
| Name | Noscapine / alpha-Narcotine / O-Methylnarcotoline | 
| CAS RN | 128-62-1 | 
| Standard InChI | InChI=1S/C22H23NO7/c1-23-8-7-11-9-14-20(29-10-28-14)21(27-4)15(11)17(23)18-12-5-6-13(25-2)19(26-3)16(12)22(24)30-18/h5-6,9,17-18H,7-8,10H2,1-4H3/t17-,18+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C22H23NO7/c1-23-8-7-11-9-14-20(29-10-28-14)21(27-4)15(11)17(23)18-12-5-6-13(25-2)19(26-3)16(12)22(24)30-18/h5-6,9,17-18H,7-8,10H2,1-4H3 | 
| Phytochemical cluster | No. 4 | 
|---|---|
| KCF-S cluster | No. 605 | 
| By standard InChI | CHEMBL364713 | 
|---|---|
| By standard InChI Main Layer | CHEMBL364713 CHEMBL402487 CHEMBL1403892 CHEMBL1570261 CHEMBL1623561 | 
| By LinkDB | C09592 | 
|---|
| By CAS RN | D009665 | 
|---|
| class name | count | 
|---|---|
| eudicotyledons | 3 | 
| family name | count | 
|---|---|
| Papaveraceae | 3 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Papaver rhoeas | 33128 | Papaveraceae | eudicotyledons | Viridiplantae | 
| Papaver rhopalothece | 3468 | Papaveraceae | eudicotyledons | Viridiplantae | 
| Papaver somniferum | 3469 | Papaveraceae | eudicotyledons | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL364713 CHEMBL1403892 | CHEMBL1614110
                        (4)
                        CHEMBL1741321
                        (3) CHEMBL1909136 (2) | 1 / 0 | 
| O15244 | Solute carrier family 22 member 2 | Drug uniporter | CHEMBL364713 | CHEMBL2320303
                        (1) | 0 / 0 | 
| Q96FL8 | Multidrug and toxin extrusion protein 1 | Cation antiporter | CHEMBL364713 | CHEMBL2320305
                        (1)
                        CHEMBL2320306
                        (1) | 0 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL364713 CHEMBL402487 | CHEMBL2114784
                        (2) | 1 / 1 | 
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL364713 | CHEMBL1909139
                        (2) | 0 / 0 | 
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL364713 | CHEMBL1909131
                        (2) | 0 / 3 | 
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL364713 | CHEMBL1909190
                        (2) | 2 / 2 | 
| P08246 | Neutrophil elastase | S1A | CHEMBL364713 | CHEMBL1909195
                        (2) | 2 / 1 | 
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL364713 | CHEMBL1909215
                        (2) | 0 / 0 | 
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL364713 | CHEMBL1909201
                        (2) | 0 / 0 | 
| P49146 | Neuropeptide Y receptor type 2 | Neuropeptide Y receptor | CHEMBL364713 | CHEMBL1909176
                        (2) | 0 / 0 | 
| P29466 | Caspase-1 | C14 | CHEMBL364713 | CHEMBL1909193
                        (2) | 0 / 0 | 
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL364713 | CHEMBL1909198
                        (2) | 0 / 0 | 
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL364713 | CHEMBL1909199
                        (2) | 0 / 0 | 
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL364713 | CHEMBL1909197
                        (2) | 2 / 2 | 
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL364713 | CHEMBL1909123
                        (2) | 1 / 2 | 
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL364713 | CHEMBL1909092
                        (2) | 0 / 1 | 
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL364713 | CHEMBL1909169
                        (2) | 1 / 1 | 
| P25021 | Histamine H2 receptor | Histamine receptor | CHEMBL364713 | CHEMBL1909157
                        (2) | 0 / 0 | 
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL364713 | CHEMBL1909156
                        (2) | 0 / 0 | 
| Q01959 | Sodium-dependent dopamine transporter | Dopamine | CHEMBL364713 | CHEMBL1909143
                        (2) | 1 / 0 | 
| P08912 | Muscarinic acetylcholine receptor M5 | Acetylcholine receptor | CHEMBL364713 | CHEMBL1909174
                        (2) | 0 / 0 | 
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL364713 | CHEMBL1909090
                        (2) | 0 / 0 | 
| P13945 | Beta-3 adrenergic receptor | Adrenergic receptor | CHEMBL364713 | CHEMBL1909093
                        (2) | 0 / 0 | 
| P25024 | C-X-C chemokine receptor type 1 | CXC chemokine receptor | CHEMBL364713 | CHEMBL1909127
                        (2) | 0 / 0 | 
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL364713 | CHEMBL1909204
                        (2) | 0 / 0 | 
| Q08209 | Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform | Ser_Thr | CHEMBL364713 | CHEMBL1909202
                        (2) | 0 / 0 | 
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL364713 CHEMBL1403892 | CHEMBL1614027
                        (5)
                        CHEMBL1741325
                        (3) CHEMBL1909135 (2) | 0 / 1 | 
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL364713 | CHEMBL1909203
                        (2) | 1 / 11 | 
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL364713 | CHEMBL1909140
                        (2) | 2 / 0 | 
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL364713 | CHEMBL1909130
                        (2) | 0 / 0 | 
| P37288 | Vasopressin V1a receptor | Vasopressin and oxytocin receptor | CHEMBL364713 | CHEMBL1909120
                        (2) | 0 / 0 | 
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL364713 | CHEMBL1909181
                        (2) | 0 / 0 | 
| Q9Y271 | Cysteinyl leukotriene receptor 1 | Leukotriene receptor | CHEMBL364713 | CHEMBL1909164
                        (2) | 0 / 0 | 
| P29274 | Adenosine receptor A2a | Adenosine receptor | CHEMBL364713 | CHEMBL1909214
                        (2) | 0 / 0 | 
| P25929 | Neuropeptide Y receptor type 1 | Neuropeptide Y receptor | CHEMBL364713 | CHEMBL1909175
                        (2) | 0 / 0 | 
| P50052 | Type-2 angiotensin II receptor | Angiotensin receptor | CHEMBL364713 | CHEMBL1909096
                        (2) | 1 / 1 | 
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL364713 | CHEMBL1909118
                        (2) | 0 / 0 | 
| P41968 | Melanocortin receptor 3 | Melanocortin receptor | CHEMBL364713 | CHEMBL1909166
                        (2) | 1 / 0 | 
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL364713 | CHEMBL943086
                        (1) | 2 / 2 | 
| P11509 | Cytochrome P450 2A6 | Cytochrome P450 2A6 | CHEMBL364713 | CHEMBL1909133
                        (2) | 0 / 0 | 
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1403892 | CHEMBL1738606
                        (1) | 0 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL364713 | CHEMBL2114780
                        (2) | 0 / 0 | 
| P51151 | Ras-related protein Rab-9A | Unclassified protein | CHEMBL364713 | CHEMBL1613838
                        (1) | 0 / 0 | 
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL364713 | CHEMBL1909158
                        (2) | 0 / 0 | 
| P08913 | Alpha-2A adrenergic receptor | Adrenergic receptor | CHEMBL364713 | CHEMBL1909088
                        (2) | 0 / 0 | 
| P21917 | D(4) dopamine receptor | Dopamine receptor | CHEMBL364713 | CHEMBL1909142
                        (2) | 0 / 0 | 
| P30988 | Calcitonin receptor | Calcitonin receptor | CHEMBL364713 | CHEMBL1909101
                        (2) | 0 / 0 | 
| P35462 | D(3) dopamine receptor | Dopamine receptor | CHEMBL364713 | CHEMBL1909141
                        (2) | 1 / 0 | 
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL364713 | CHEMBL1909180
                        (2) | 0 / 0 | 
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL364713 | CHEMBL1909146
                        (2) | 0 / 1 | 
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL364713 | CHEMBL1909104
                        (2) | 0 / 0 | 
| P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL364713 | CHEMBL1909144
                        (2) | 0 / 0 | 
| P30411 | B2 bradykinin receptor | Bradykinin receptor | CHEMBL364713 | CHEMBL1909100
                        (2) | 0 / 0 | 
| P32245 | Melanocortin receptor 4 | Melanocortin receptor | CHEMBL364713 | CHEMBL1909167
                        (2) | 1 / 0 | 
| P32238 | Cholecystokinin receptor type A | Cholecystokinin receptor | CHEMBL364713 | CHEMBL1909129
                        (2) | 0 / 0 | 
| P08311 | Cathepsin G | S1A | CHEMBL364713 | CHEMBL1909194
                        (2) | 0 / 0 | 
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL364713 | CHEMBL1909110
                        (2) | 1 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL402487 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P03956 | Interstitial collagenase | M10A | CHEMBL364713 | CHEMBL1909196
                        (2) | 0 / 1 | 
| P32241 | Vasoactive intestinal polypeptide receptor 1 | Vasoactive intestinal peptide receptor | CHEMBL364713 | CHEMBL1909119
                        (2) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL364713 | CHEMBL1738610
                        (1) | 0 / 0 | 
| Q9HC16 | DNA dC->dU-editing enzyme APOBEC-3G | Enzyme | CHEMBL364713 CHEMBL402487 | CHEMBL1963863
                        (2) | 0 / 0 | 
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL364713 | CHEMBL1909150
                        (2) | 0 / 1 | 
| P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL364713 | CHEMBL1909171
                        (2) | 2 / 0 | 
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL364713 | CHEMBL1909170
                        (2) | 0 / 0 | 
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL364713 | CHEMBL1909122
                        (2) | 0 / 0 | 
| P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL364713 | CHEMBL1909109
                        (2) | 2 / 0 | 
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL364713 | CHEMBL1909205
                        (2) | 5 / 10 | 
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL364713 | CHEMBL1909172
                        (2) | 1 / 0 | 
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL364713 | CHEMBL1909114
                        (2) | 0 / 0 | 
| P51679 | C-C chemokine receptor type 4 | CC chemokine receptor | CHEMBL364713 | CHEMBL1909125
                        (2) | 0 / 0 | 
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL364713 | CHEMBL1909126
                        (2) | 3 / 0 | 
| P50406 | 5-hydroxytryptamine receptor 6 | Serotonin receptor | CHEMBL364713 | CHEMBL1909108
                        (2) | 0 / 0 | 
| P41597 | C-C chemokine receptor type 2 | CC chemokine receptor | CHEMBL364713 | CHEMBL1909124
                        (2) | 1 / 0 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL364713 | CHEMBL1613808
                        (1)
                        CHEMBL1909200
                        (2) | 0 / 0 | 
| P08575 | Receptor-type tyrosine-protein phosphatase C | Enzyme | CHEMBL364713 | CHEMBL1909207
                        (2) | 2 / 1 | 
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL364713 CHEMBL1403892 | CHEMBL1741322
                        (3)
                        CHEMBL1909132
                        (2) | 0 / 0 | 
| Q92887 | Canalicular multispecific organic anion transporter 1 | Unclassified protein | CHEMBL364713 | CHEMBL1006005
                        (1) | 1 / 1 | 
| Q86VL8 | Multidrug and toxin extrusion protein 2 | Cation antiporter | CHEMBL364713 | CHEMBL2320300
                        (1) | 0 / 0 | 
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL364713 | CHEMBL1909186
                        (2) | 0 / 0 | 
| P03372 | Estrogen receptor | NR3A1 | CHEMBL364713 | CHEMBL1909145
                        (2) | 1 / 1 | 
| P08588 | Beta-1 adrenergic receptor | Adrenergic receptor | CHEMBL364713 | CHEMBL1909091
                        (2) | 1 / 0 | 
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL364713 | CHEMBL1909212
                        (2) | 1 / 0 | 
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL364713 | CHEMBL1909211
                        (2) | 0 / 0 | 
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL364713 | CHEMBL1909105
                        (2) | 0 / 0 | 
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL364713 | CHEMBL1909182
                        (2) | 0 / 0 | 
| P08173 | Muscarinic acetylcholine receptor M4 | Acetylcholine receptor | CHEMBL364713 | CHEMBL1909173
                        (2) | 0 / 0 | 
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL364713 | CHEMBL1909113
                        (2) | 0 / 0 | 
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL364713 | CHEMBL1909187
                        (2) | 0 / 0 | 
| P33032 | Melanocortin receptor 5 | Melanocortin receptor | CHEMBL364713 | CHEMBL1909168
                        (2) | 0 / 0 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL364713 CHEMBL1403892 | CHEMBL1613777
                        (5)
                        CHEMBL1741323
                        (3) CHEMBL1909134 (2) | 1 / 1 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL364713 CHEMBL1403892 CHEMBL1570261 | CHEMBL1614108
                        (4)
                        CHEMBL1613886
                        (4) CHEMBL1741324 (3) CHEMBL1909138 (2) | 0 / 1 | 
| P05181 | Cytochrome P450 2E1 | Cytochrome P450 2E1 | CHEMBL364713 | CHEMBL1909137
                        (2) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL364713 | CHEMBL1737980
                        (1)
                        CHEMBL1738184
                        (1) | 0 / 0 | 
| P23975 | Sodium-dependent noradrenaline transporter | Norepinephrine | CHEMBL364713 | CHEMBL1909094
                        (2) | 1 / 1 | 
| P25100 | Alpha-1D adrenergic receptor | Adrenergic receptor | CHEMBL364713 | CHEMBL1909087
                        (2) | 0 / 0 | 
| P30542 | Adenosine receptor A1 | Adenosine receptor | CHEMBL364713 | CHEMBL1909213
                        (2) | 0 / 0 | 
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL364713 | CHEMBL1909089
                        (2) | 0 / 0 | 
| P24557 | Thromboxane-A synthase | Cytochrome P450 5A1 | CHEMBL364713 | CHEMBL1909116
                        (2) | 1 / 1 | 
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL364713 | CHEMBL1909206
                        (2) | 0 / 1 | 
| P25025 | C-X-C chemokine receptor type 2 | CXC chemokine receptor | CHEMBL364713 | CHEMBL1909128
                        (2) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL364713 | CHEMBL1738442
                        (1) | 0 / 0 | 
| O00255 | Menin | Unclassified protein | CHEMBL364713 | CHEMBL1614531
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL364713 | CHEMBL1614531
                        (1) | 1 / 3 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| D009665 | 581 | BAX BCL2L4 | BCL2-associated X protein | Noscapine promotes the reaction [Cisplatin results in increased expression of BAX protein] | increases expression / increases reaction | protein | 20674069 | 
| D009665 | 581 | BAX BCL2L4 | BCL2-associated X protein | Noscapine results in increased expression of BAX protein | increases expression | protein | 20674069 | 
| D009665 | 596 | BCL2 Bcl-2 PPP1R50 | B-cell CLL/lymphoma 2 | Noscapine promotes the reaction [Cisplatin results in decreased expression of BCL2 protein] | decreases expression / increases reaction | protein | 20674069 | 
| D009665 | 596 | BCL2 Bcl-2 PPP1R50 | B-cell CLL/lymphoma 2 | Noscapine results in decreased expression of BCL2 protein | decreases expression | protein | 20674069 | 
| D009665 | 332 | BIRC5 API4 EPR-1 | baculoviral IAP repeat containing 5 | BIRC5 protein results in decreased susceptibility to Noscapine | decreases response to substance | protein | 22848370 | 
| D009665 | 332 | BIRC5 API4 EPR-1 | baculoviral IAP repeat containing 5 | Noscapine promotes the reaction [Cisplatin results in decreased expression of BIRC5 protein] | decreases expression / increases reaction | protein | 20674069 | 
| D009665 | 332 | BIRC5 API4 EPR-1 | baculoviral IAP repeat containing 5 | Noscapine results in decreased expression of BIRC5 protein | decreases expression | protein | 20674069 | 
| D009665 | 332 | BIRC5 API4 EPR-1 | baculoviral IAP repeat containing 5 | Noscapine results in increased expression of BIRC5 mRNA | increases expression | mRNA | 22848370 | 
| D009665 | 332 | BIRC5 API4 EPR-1 | baculoviral IAP repeat containing 5 | Noscapine results in increased expression of BIRC5 protein | increases expression | protein | 22848370 | 
| D009665 | 836 | CASP3 CPP32 CPP32B SCA-1 | caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | [Noscapine co-treated with Cisplatin] results in increased cleavage of CASP3 protein | affects cotreatment / increases cleavage | protein | 20674069 | 
| D009665 | 836 | CASP3 CPP32 CPP32B SCA-1 | caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | Noscapine promotes the reaction [Cisplatin results in increased expression of and results in increased cleavage of CASP3 protein] | increases cleavage / increases expression / increases reaction | protein | 20674069 | 
| D009665 | 836 | CASP3 CPP32 CPP32B SCA-1 | caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | Noscapine results in increased activity of CASP3 protein | increases activity | protein | 22848370 | 
| D009665 | 836 | CASP3 CPP32 CPP32B SCA-1 | caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | Noscapine results in increased expression of and results in increased cleavage of CASP3 protein | increases cleavage / increases expression | protein | 20674069 | 
| D009665 | 842 | CASP9 APAF-3 APAF3 ICE-LAP6 MCH6 PPP1R56 | caspase 9, apoptosis-related cysteine peptidase (EC:3.4.22.62) | Noscapine promotes the reaction [Cisplatin results in increased expression of and results in increased cleavage of CASP9 protein] | increases cleavage / increases expression / increases reaction | protein | 20674069 | 
| D009665 | 842 | CASP9 APAF-3 APAF3 ICE-LAP6 MCH6 PPP1R56 | caspase 9, apoptosis-related cysteine peptidase (EC:3.4.22.62) | Noscapine results in increased expression of and results in increased cleavage of CASP9 protein | increases cleavage / increases expression | protein | 20674069 | 
| D009665 | 1026 | CDKN1A CAP20 CDKN1 CIP1 MDA-6 P21 SDI1 WAF1 p21CIP1 | cyclin-dependent kinase inhibitor 1A (p21, Cip1) | Noscapine promotes the reaction [Cisplatin results in increased expression of CDKN1A protein] | increases expression / increases reaction | protein | 20674069 | 
| D009665 | 1026 | CDKN1A CAP20 CDKN1 CIP1 MDA-6 P21 SDI1 WAF1 p21CIP1 | cyclin-dependent kinase inhibitor 1A (p21, Cip1) | Noscapine results in increased expression of CDKN1A protein | increases expression | protein | 20674069 | 
| D009665 | 1543 | CYP1A1 AHH AHRR CP11 CYP1 P1-450 P450-C P450DX | cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | Noscapine inhibits the reaction [Tetrachlorodibenzodioxin results in increased activity of CYP1A1 protein] | decreases reaction / increases activity | protein | 18493746 | 
| D009665 | 3091 | HIF1A HIF-1A HIF-1alpha HIF1 HIF1-ALPHA MOP1 PASD8 bHLHe78 | hypoxia inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor) | Noscapine results in increased degradation of and results in decreased expression of and results in decreased activity of HIF1A protein | decreases activity / decreases expression / increases degradation | protein | 16596621 | 
| D009665 | 142 | PARP1 ADPRT ADPRT_1 ADPRT1 ARTD1 PARP PARP-1 PPOL pADPRT-1 | poly (ADP-ribose) polymerase 1 (EC:2.4.2.30) | Noscapine results in increased cleavage of PARP1 protein | increases cleavage | protein | 22848370 | 
| D009665 | 7157 | TP53 BCC7 LFS1 P53 TRP53 | tumor protein p53 | Noscapine promotes the reaction [Cisplatin results in increased expression of TP53 protein] | increases expression / increases reaction | protein | 20674069 | 
| D009665 | 7157 | TP53 BCC7 LFS1 P53 TRP53 | tumor protein p53 | Noscapine results in increased expression of and results in increased phosphorylation of TP53 protein | increases expression / increases phosphorylation | protein | 22848370 | 
| D009665 | 7157 | TP53 BCC7 LFS1 P53 TRP53 | tumor protein p53 | Noscapine results in increased expression of TP53 protein | increases expression | protein | 20674069 | 
| D009665 | 7422 | VEGFA MVCD1 VEGF VPF | vascular endothelial growth factor A | Noscapine results in decreased secretion of VEGFA protein | decreases secretion | protein | 16596621 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism | P20309 | 
| #103780 | Alcohol dependence | P08172 P14416 P31645 | 
| #614373 | Amyotrophic lateral sclerosis 16, juvenile; als16 | Q99720 | 
| #602025 | Body mass index quantitative trait locus 9; bmiq9 | P41968 | 
| #300615 | Brunner syndrome | P21397 | 
| #162800 | Cyclic neutropenia | P08246 | 
| #612522 | Diabetes mellitus, insulin-dependent, 22; iddm22 | P51681 | 
| #609535 | Drug metabolism, poor, cyp2c19-related | P33261 | 
| #608902 | Drug metabolism, poor, cyp2d6-related | P10635 | 
| #237500 | Dubin-johnson syndrome; djs | Q92887 | 
| #615363 | Estrogen resistance; estrr | P03372 | 
| #613659 | Gastric cancer | P04626 | 
| #137215 | Gastric cancer, hereditary diffuse; hdgc | P04626 | 
| #231095 | Ghosal hematodiaphyseal dysplasia; ghdd | P24557 | 
| #137800 | Glioma susceptibility 1; glm1 | P04626 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #609423 | Human immunodeficiency virus type 1, susceptibility to | P41597 P51681 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #603932 | Intervertebral disc disease; idd | P14780 | 
| #613688 | Long qt syndrome 2; lqt2 | Q12809 | 
| #211980 | Lung cancer | P00533 P04626 | 
| #608516 | Major depressive disorder; mdd | P08172 | 
| %300852 | Mental retardation, x-linked 88; mrx88 | P50052 | 
| #613073 | Metaphyseal anadysplasia 2; mandp2 | P14780 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| #126200 | Multiple sclerosis, susceptibility to; ms | P08575 | 
| #159900 | Myoclonic dystonia | P14416 | 
| #202700 | Neutropenia, severe congenital, 1, autosomal dominant; scn1 | P08246 | 
| #257200 | Niemann-pick disease, type a | P17405 | 
| #607616 | Niemann-pick disease, type b | P17405 | 
| #601665 | Obesity | P32245 | 
| #164230 | Obsessive-compulsive disorder; ocd | P31645 | 
| #604715 | Orthostatic intolerance | P23975 | 
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 | P00918 | 
| #167000 | Ovarian cancer | P04626 | 
| #613135 | Parkinsonism-dystonia, infantile; pkdys | Q01959 | 
| #607276 | Resting heart rate, variation in | P08588 | 
| #608971 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-positive | P08575 | 
| #609620 | Short qt syndrome 1; sqt1 | Q12809 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #190300 | Tremor, hereditary essential, 1; etm1 | P35462 | 
| #610379 | West nile virus, susceptibility to | P51681 | 
| #112100 | Yt blood group antigen | P22303 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00016 | Oral cancer | P00533
                            (related) P00533 (marker) | 
| H00017 | Esophageal cancer | P00533
                            (related) P35354 (related) | 
| H00018 | Gastric cancer | P00533
                            (related) P04626 (related) | 
| H00022 | Bladder cancer | P00533
                            (related) P04626 (related) | 
| H00028 | Choriocarcinoma | P00533
                            (related) P03956 (related) P04626 (related) | 
| H00030 | Cervical cancer | P00533
                            (related) P04626 (related) | 
| H00042 | Glioma | P00533
                            (related) P00533 (marker) | 
| H00055 | Laryngeal cancer | P00533
                            (related) P00533 (marker) | 
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) | P00918
                            (related) | 
| H00436 | Osteopetrosis | P00918
                            (related) | 
| H00026 | Endometrial Cancer | P03372
                            (marker) P04626 (related) Q92731 (marker) | 
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) | P04150
                            (related) | 
| H00019 | Pancreatic cancer | P04626
                            (related) | 
| H00027 | Ovarian cancer | P04626
                            (related) | 
| H00031 | Breast cancer | P04626
                            (related) P04626 (marker) | 
| H00046 | Cholangiocarcinoma | P04626
                            (related) P35354 (related) | 
| H00093 | Combined immunodeficiencies (CIDs) | P06239
                            (related) | 
| H00079 | Asthma | P07550
                            (related) | 
| H00100 | Neutropenic disorders | P08246
                            (related) | 
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) | P08575
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H01205 | Coumarin resistance | P11712
                            (related) | 
| H00025 | Penile cancer | P14780
                            (related) P35354 (related) | 
| H00479 | Metaphyseal dysplasias | P14780
                            (related) | 
| H00137 | Niemann-Pick disease (NPD) typeA and B | P17405
                            (related) | 
| H00424 | Defects in the degradation of sphingomyelin | P17405
                            (related) | 
| H00548 | Brunner syndrome | P21397
                            (related) | 
| H01031 | Orthostatic intolerance (OI) | P23975
                            (related) | 
| H00490 | Diaphyseal dysplasia with anemia (Ghosal) | P24557
                            (related) | 
| H01171 | Poor drug metabolism (PM) | P33261
                            (related) | 
| H00480 | Non-syndromic X-linked mental retardation | P50052
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) | 
| H00720 | Long QT syndrome | Q12809
                            (related) | 
| H00725 | Short QT syndrome | Q12809
                            (related) | 
| H00208 | Hyperbilirubinemia | Q92887
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) | 
| MeSH disease | OMIM | compound | disease name | evidence type | reference pmid | 
|---|---|---|---|---|---|
| D003371 | D009665 | Cough | therapeutic | 16596228 | |
| D003711 | D009665 | Demyelinating Diseases | therapeutic | 18766974 | |
| D005910 | D009665 | Glioma | therapeutic | 16596228 | |
| D015473 | D009665 | Leukemia, Promyelocytic, Acute | therapeutic | 18766974 | |
| D015458 | D009665 | Leukemia, T-Cell | therapeutic | 18766974 |