| id | C00019788 |
|---|---|
| Name | Anisocoumarin H |
| CAS RN | 123237-86-5 |
| Standard InChI | InChI=1S/C19H22O4/c1-13(2)10-16(20)11-14(3)8-9-22-17-6-4-15-5-7-19(21)23-18(15)12-17/h4-8,10,12,16,20H,9,11H2,1-3H3/b14-8+ |
| Standard InChI (Main Layer) | InChI=1S/C19H22O4/c1-13(2)10-16(20)11-14(3)8-9-22-17-6-4-15-5-7-19(21)23-18(15)12-17/h4-8,10,12,16,20H,9,11H2,1-3H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 335 |
| By standard InChI | CHEMBL408980 |
|---|---|
| By standard InChI Main Layer | CHEMBL408980 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Clausena anisata | 159034 | Rutaceae | rosids | Viridiplantae |
| Melicope semecarpifolia | 697038 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL408980 |
CHEMBL932680
(1)
CHEMBL932681
(1)
|
0 / 0 |
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL408980 |
CHEMBL1794495
(1)
|
2 / 2 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL408980 |
CHEMBL1738606
(1)
|
0 / 0 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL408980 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL408980 |
CHEMBL2114843
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL408980 |
CHEMBL2114788
(1)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL408980 |
CHEMBL1738184
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL408980 |
CHEMBL1613914
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL408980 |
CHEMBL2354311
(1)
|
1 / 0 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL408980 |
CHEMBL2354287
(1)
|
1 / 1 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 |
Q13148
|
| #114500 | Colorectal cancer; crc |
P84022
|
| #137800 | Glioma susceptibility 1; glm1 |
O75874
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #257200 | Niemann-pick disease, type a |
P17405
|
| #607616 | Niemann-pick disease, type b |
P17405
|