| id | C00019875 | 
|---|---|
| Name | Fraxidin | 
| CAS RN | 525-21-3 | 
| Standard InChI | InChI=1S/C11H10O5/c1-14-7-5-6-3-4-8(12)16-10(6)9(13)11(7)15-2/h3-5,13H,1-2H3 | 
| Standard InChI (Main Layer) | InChI=1S/C11H10O5/c1-14-7-5-6-3-4-8(12)16-10(6)9(13)11(7)15-2/h3-5,13H,1-2H3 | 
| Phytochemical cluster | No. 25 | 
|---|---|
| KCF-S cluster | No. 364 | 
| By standard InChI | CHEMBL2334351 | 
|---|---|
| By standard InChI Main Layer | CHEMBL2334351 | 
| By LinkDB | C17479 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 5 | 
| rosids | 2 | 
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Asteraceae | 3 | 
| Malvaceae | 2 | 
| Apiaceae | 1 | 
| Oleaceae | 1 | 
| Amaranthaceae | 1 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P43166 | Carbonic anhydrase 7 | Lyase | CHEMBL2334351 | CHEMBL2341285
                        (1) | 0 / 0 | 
| Q8N1Q1 | Carbonic anhydrase 13 | Lyase | CHEMBL2334351 | CHEMBL2341282
                        (1) | 0 / 0 | 
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL2334351 | CHEMBL2341286
                        (1) | 1 / 2 | 
| O43570 | Carbonic anhydrase 12 | Lyase | CHEMBL2334351 | CHEMBL2341283
                        (1) | 1 / 2 | 
| P00915 | Carbonic anhydrase 1 | Lyase | CHEMBL2334351 | CHEMBL2341287
                        (1) | 0 / 0 | 
| Q16790 | Carbonic anhydrase 9 | Lyase | CHEMBL2334351 | CHEMBL2341284
                        (1) | 0 / 1 |