| id | C00020344 |
|---|---|
| Name | 7,4'-Dimethoxyflavone |
| CAS RN | 20979-50-4 |
| Standard InChI | InChI=1S/C17H14O4/c1-19-12-5-3-11(4-6-12)16-10-15(18)14-8-7-13(20-2)9-17(14)21-16/h3-10H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O4/c1-19-12-5-3-11(4-6-12)16-10-15(18)14-8-7-13(20-2)9-17(14)21-16/h3-10H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 35 |
| By standard InChI | CHEMBL16442 |
|---|---|
| By standard InChI Main Layer | CHEMBL16442 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| rosids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Myristicaceae | 1 |
| Fabaceae | 1 |
| Poaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Gynerium sagittatum | 42053 | Poaceae | Liliopsida | Viridiplantae |
| Trigonella foenum-graecum | 78534 | Fabaceae | rosids | Viridiplantae |
| Virola carinata | 224865 | Myristicaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL16442 |
CHEMBL1071596
(1)
|
0 / 0 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL16442 |
CHEMBL1071594
(1)
|
1 / 1 |