| id | C00002149 |
|---|---|
| Name | Deoxypeganine |
| CAS RN | 495-59-0 |
| Standard InChI | InChI=1S/C11H12N2/c1-2-5-10-9(4-1)8-13-7-3-6-11(13)12-10/h1-2,4-5H,3,6-8H2 |
| Standard InChI (Main Layer) | InChI=1S/C11H12N2/c1-2-5-10-9(4-1)8-13-7-3-6-11(13)12-10/h1-2,4-5H,3,6-8H2 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 2365 |
| By standard InChI | CHEMBL355821 |
|---|---|
| By standard InChI Main Layer | CHEMBL355821 |
| By LinkDB | C10656 |
|---|
| By CAS RN | C048835 |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Nitrariaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Peganum harmala | 43879 | Nitrariaceae | rosids | Viridiplantae |
| Peganum nigellastrum | 673036 | Nitrariaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL355821 |
CHEMBL644110
(1)
|
1 / 0 |