id | C00002149 |
---|---|
Name | Deoxypeganine |
CAS RN | 495-59-0 |
Standard InChI | InChI=1S/C11H12N2/c1-2-5-10-9(4-1)8-13-7-3-6-11(13)12-10/h1-2,4-5H,3,6-8H2 |
Standard InChI (Main Layer) | InChI=1S/C11H12N2/c1-2-5-10-9(4-1)8-13-7-3-6-11(13)12-10/h1-2,4-5H,3,6-8H2 |
Phytochemical cluster | No. 7 |
---|---|
KCF-S cluster | No. 2365 |
By standard InChI | CHEMBL355821 |
---|---|
By standard InChI Main Layer | CHEMBL355821 |
By LinkDB | C10656 |
---|
By CAS RN | C048835 |
---|
class name | count |
---|---|
rosids | 2 |
family name | count |
---|---|
Nitrariaceae | 2 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Peganum harmala | 43879 | Nitrariaceae | rosids | Viridiplantae |
Peganum nigellastrum | 673036 | Nitrariaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P22303 | Acetylcholinesterase | Hydrolase | CHEMBL355821 |
CHEMBL644110
(1)
|
1 / 0 |