| id | C00002288 |
|---|---|
| Name | Convoline |
| CAS RN | 89783-61-9 |
| Standard InChI | InChI=1S/C16H21NO5/c1-20-14-6-3-10(7-15(14)21-2)16(18)22-13-8-11-4-5-12(9-13)17(11)19/h3,6-7,11-13,19H,4-5,8-9H2,1-2H3/t11-,12?,13-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H21NO5/c1-20-14-6-3-10(7-15(14)21-2)16(18)22-13-8-11-4-5-12(9-13)17(11)19/h3,6-7,11-13,19H,4-5,8-9H2,1-2H3 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 1355 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1890337 |
| By LinkDB | C10855 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Convolvulaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Convolvulus krauseanus | 4122 | Convolvulaceae | asterids | Viridiplantae |
| Evolvulus sericeus | 113201 | Convolvulaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75496 | Geminin | Unclassified protein | CHEMBL1890337 |
CHEMBL2114843
(1)
|
0 / 0 |