| id | C00024524 |
|---|---|
| Name | Cathovalinine |
| CAS RN | 61825-77-2 |
| Standard InChI | InChI=1S/C21H24N2O4/c1-11(24)21-9-12(18(25)26-2)16-20(13-5-3-4-6-14(13)22-16)7-8-23(19(20)21)10-15-17(21)27-15/h3-6,11,15,17,19,22,24H,7-10H2,1-2H3/t11-,15-,17-,19+,20-,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H24N2O4/c1-11(24)21-9-12(18(25)26-2)16-20(13-5-3-4-6-14(13)22-16)7-8-23(19(20)21)10-15-17(21)27-15/h3-6,11,15,17,19,22,24H,7-10H2,1-2H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 61 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| family name | count |
|---|---|
| Apocynaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Catharanthus ovalis | 1167200 | Apocynaceae | asterids | Viridiplantae |
| Melodinus suaveolens | 582714 | Apocynaceae | asterids | Viridiplantae |