id | C00024934 |
---|---|
Name | Songorin / Zongorine / Napellonine |
CAS RN | 509-24-0 |
Standard InChI | InChI=1S/C22H31NO3/c1-4-23-10-20(3)6-5-17(25)22-15(20)7-13(18(22)23)21-9-12(11(2)19(21)26)14(24)8-16(21)22/h12-13,15-19,25-26H,2,4-10H2,1,3H3/t12-,13?,15-,16-,17+,18?,19-,20-,21+,22?/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C22H31NO3/c1-4-23-10-20(3)6-5-17(25)22-15(20)7-13(18(22)23)21-9-12(11(2)19(21)26)14(24)8-16(21)22/h12-13,15-19,25-26H,2,4-10H2,1,3H3 |
Phytochemical cluster | No. 10 |
---|---|
KCF-S cluster | No. 124 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1895895 CHEMBL2165580 |
By LinkDB | C08707 |
---|
By CAS RN | C057217 |
---|
class name | count |
---|---|
eudicotyledons | 9 |
family name | count |
---|---|
Ranunculaceae | 9 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1895895 |
CHEMBL1794536
(1)
|
0 / 0 |